C8H10O5 — CID 146361986
2-oxalocyclopentane-1-carboxylic acid (PubChem CID 146361986) has the molecular formula C8H10O5 and a molecular weight of 186.16 g/mol. Its IUPAC name is 2-oxalocyclopentane-1-carboxylic acid.
| Compound Name | 2-oxalocyclopentane-1-carboxylic acid |
|---|---|
| PubChem CID | 146361986 |
| Molecular Formula | C8H10O5 |
| Molecular Weight | 186.16 g/mol |
| Exact Mass | 186.05 |
| IUPAC Name | 2-oxalocyclopentane-1-carboxylic acid |
| SMILES | O=C(O)C(=O)C1CCCC1C(=O)O |
| InChI | InChI=1S/C8H10O5/c9-6(8(12)13)4-2-1-3-5(4)7(10)11/h4-5H,1-3H2,(H,10,11)(H,12,13) |
| InChIKey | HWLNOMCWZUAARK-UHFFFAOYSA-N |
| XLogP | 0.14 |
| TPSA | 91.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.16 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|