About (5S)-6,6-difluoro-2-pentyl-2,9-diazaspiro[4.5]decane
(5S)-6,6-difluoro-2-pentyl-2,9-diazaspiro[4.5]decane (PubChem CID 146362021) has the molecular formula C13H24F2N2
and a molecular weight of 246.34 g/mol. Its IUPAC name is (5S)-6,6-difluoro-2-pentyl-2,9-diazaspiro[4.5]decane.
Molecular Properties
| Compound Name | (5S)-6,6-difluoro-2-pentyl-2,9-diazaspiro[4.5]decane |
| PubChem CID | 146362021 |
| Molecular Formula | C13H24F2N2 |
| Molecular Weight | 246.34 g/mol |
| Exact Mass | 246.19 |
| IUPAC Name | (5S)-6,6-difluoro-2-pentyl-2,9-diazaspiro[4.5]decane |
| SMILES | CCCCCN1CC[C@]2(CNCCC2(F)F)C1 |
| InChI | InChI=1S/C13H24F2N2/c1-2-3-4-8-17-9-6-12(11-17)10-16-7-5-13(12,14)15/h16H,2-11H2,1H3/t12-/m0/s1 |
| InChIKey | NBKTTZHFMXSBAE-LBPRGKRZSA-N |
| XLogP | 2.50 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.34 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze (5S)-6,6-difluoro-2-pentyl-2,9-diazaspiro[4.5]decane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5S)-6,6-difluoro-2-pentyl-2,9-diazaspiro[4.5]decane?
The IUPAC name of (5S)-6,6-difluoro-2-pentyl-2,9-diazaspiro[4.5]decane (CID 146362021) is (5S)-6,6-difluoro-2-pentyl-2,9-diazaspiro[4.5]decane.
What is the SMILES notation for (5S)-6,6-difluoro-2-pentyl-2,9-diazaspiro[4.5]decane?
The canonical SMILES for (5S)-6,6-difluoro-2-pentyl-2,9-diazaspiro[4.5]decane is CCCCCN1CC[C@]2(CNCCC2(F)F)C1.
What is the InChIKey of (5S)-6,6-difluoro-2-pentyl-2,9-diazaspiro[4.5]decane?
The InChIKey is NBKTTZHFMXSBAE-LBPRGKRZSA-N. The full InChI is InChI=1S/C13H24F2N2/c1-2-3-4-8-17-9-6-12(11-17)10-16-7-5-13(12,14)15/h16H,2-11H2,1H3/t12-/m0/s1.
What are the key properties of (5S)-6,6-difluoro-2-pentyl-2,9-diazaspiro[4.5]decane?
(5S)-6,6-difluoro-2-pentyl-2,9-diazaspiro[4.5]decane has a molecular weight of 246.34 g/mol, XLogP of 2.50, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (5S)-6,6-difluoro-2-pentyl-2,9-diazaspiro[4.5]decane is sourced from PubChem (CID 146362021), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).