About (8R)-6-heptan-3-yl-3,6-diazatricyclo[3.2.1.03,8]octane
(8R)-6-heptan-3-yl-3,6-diazatricyclo[3.2.1.03,8]octane (PubChem CID 146362025) has the molecular formula C13H24N2
and a molecular weight of 208.35 g/mol. Its IUPAC name is (8R)-6-heptan-3-yl-3,6-diazatricyclo[3.2.1.03,8]octane.
Molecular Properties
| Compound Name | (8R)-6-heptan-3-yl-3,6-diazatricyclo[3.2.1.03,8]octane |
| PubChem CID | 146362025 |
| Molecular Formula | C13H24N2 |
| Molecular Weight | 208.35 g/mol |
| Exact Mass | 208.19 |
| IUPAC Name | (8R)-6-heptan-3-yl-3,6-diazatricyclo[3.2.1.03,8]octane |
| SMILES | CCCCC(CC)N1CC2CN3CC1[C@@H]23 |
| InChI | InChI=1S/C13H24N2/c1-3-5-6-11(4-2)15-8-10-7-14-9-12(15)13(10)14/h10-13H,3-9H2,1-2H3/t10?,11?,12?,13-/m1/s1 |
| InChIKey | CLRGTGDHFATRQH-NODFVKRRSA-N |
| XLogP | 1.95 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.35 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (8R)-6-heptan-3-yl-3,6-diazatricyclo[3.2.1.03,8]octane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (8R)-6-heptan-3-yl-3,6-diazatricyclo[3.2.1.03,8]octane?
The IUPAC name of (8R)-6-heptan-3-yl-3,6-diazatricyclo[3.2.1.03,8]octane (CID 146362025) is (8R)-6-heptan-3-yl-3,6-diazatricyclo[3.2.1.03,8]octane.
What is the SMILES notation for (8R)-6-heptan-3-yl-3,6-diazatricyclo[3.2.1.03,8]octane?
The canonical SMILES for (8R)-6-heptan-3-yl-3,6-diazatricyclo[3.2.1.03,8]octane is CCCCC(CC)N1CC2CN3CC1[C@@H]23.
What is the InChIKey of (8R)-6-heptan-3-yl-3,6-diazatricyclo[3.2.1.03,8]octane?
The InChIKey is CLRGTGDHFATRQH-NODFVKRRSA-N. The full InChI is InChI=1S/C13H24N2/c1-3-5-6-11(4-2)15-8-10-7-14-9-12(15)13(10)14/h10-13H,3-9H2,1-2H3/t10?,11?,12?,13-/m1/s1.
What are the key properties of (8R)-6-heptan-3-yl-3,6-diazatricyclo[3.2.1.03,8]octane?
(8R)-6-heptan-3-yl-3,6-diazatricyclo[3.2.1.03,8]octane has a molecular weight of 208.35 g/mol, XLogP of 1.95, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (8R)-6-heptan-3-yl-3,6-diazatricyclo[3.2.1.03,8]octane is sourced from PubChem (CID 146362025), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).