About (3Z,4Z)-4-ethylidene-3-prop-2-enylidenecyclohexa-1,5-diene-1-carbonitrile
(3Z,4Z)-4-ethylidene-3-prop-2-enylidenecyclohexa-1,5-diene-1-carbonitrile (PubChem CID 146362499) has the molecular formula C12H11N
and a molecular weight of 169.23 g/mol. Its IUPAC name is (3Z,4Z)-4-ethylidene-3-prop-2-enylidenecyclohexa-1,5-diene-1-carbonitrile.
Molecular Properties
| Compound Name | (3Z,4Z)-4-ethylidene-3-prop-2-enylidenecyclohexa-1,5-diene-1-carbonitrile |
| PubChem CID | 146362499 |
| Molecular Formula | C12H11N |
| Molecular Weight | 169.23 g/mol |
| Exact Mass | 169.09 |
| IUPAC Name | (3Z,4Z)-4-ethylidene-3-prop-2-enylidenecyclohexa-1,5-diene-1-carbonitrile |
| SMILES | C=C/C=c1/cc(C#N)cc/c1=C/C |
| InChI | InChI=1S/C12H11N/c1-3-5-12-8-10(9-13)6-7-11(12)4-2/h3-8H,1H2,2H3/b11-4-,12-5- |
| InChIKey | KXYWWBJACDWZEE-VQCVYIJISA-N |
| XLogP | 1.33 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 169.23 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (3Z,4Z)-4-ethylidene-3-prop-2-enylidenecyclohexa-1,5-diene-1-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3Z,4Z)-4-ethylidene-3-prop-2-enylidenecyclohexa-1,5-diene-1-carbonitrile?
The IUPAC name of (3Z,4Z)-4-ethylidene-3-prop-2-enylidenecyclohexa-1,5-diene-1-carbonitrile (CID 146362499) is (3Z,4Z)-4-ethylidene-3-prop-2-enylidenecyclohexa-1,5-diene-1-carbonitrile.
What is the SMILES notation for (3Z,4Z)-4-ethylidene-3-prop-2-enylidenecyclohexa-1,5-diene-1-carbonitrile?
The canonical SMILES for (3Z,4Z)-4-ethylidene-3-prop-2-enylidenecyclohexa-1,5-diene-1-carbonitrile is C=C/C=c1/cc(C#N)cc/c1=C/C.
What is the InChIKey of (3Z,4Z)-4-ethylidene-3-prop-2-enylidenecyclohexa-1,5-diene-1-carbonitrile?
The InChIKey is KXYWWBJACDWZEE-VQCVYIJISA-N. The full InChI is InChI=1S/C12H11N/c1-3-5-12-8-10(9-13)6-7-11(12)4-2/h3-8H,1H2,2H3/b11-4-,12-5-.
What are the key properties of (3Z,4Z)-4-ethylidene-3-prop-2-enylidenecyclohexa-1,5-diene-1-carbonitrile?
(3Z,4Z)-4-ethylidene-3-prop-2-enylidenecyclohexa-1,5-diene-1-carbonitrile has a molecular weight of 169.23 g/mol, XLogP of 1.33, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (3Z,4Z)-4-ethylidene-3-prop-2-enylidenecyclohexa-1,5-diene-1-carbonitrile is sourced from PubChem (CID 146362499), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).