About 5,5-dimethylazepine-2,3-diamine
5,5-dimethylazepine-2,3-diamine (PubChem CID 146363123) has the molecular formula C8H13N3
and a molecular weight of 151.21 g/mol. Its IUPAC name is 5,5-dimethylazepine-2,3-diamine.
Molecular Properties
| Compound Name | 5,5-dimethylazepine-2,3-diamine |
| PubChem CID | 146363123 |
| Molecular Formula | C8H13N3 |
| Molecular Weight | 151.21 g/mol |
| Exact Mass | 151.11 |
| IUPAC Name | 5,5-dimethylazepine-2,3-diamine |
| SMILES | CC1(C)C=CN=C(N)C(N)=C1 |
| InChI | InChI=1S/C8H13N3/c1-8(2)3-4-11-7(10)6(9)5-8/h3-5H,9H2,1-2H3,(H2,10,11) |
| InChIKey | OIQCAPOTDXSGDQ-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 64.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 151.21 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5,5-dimethylazepine-2,3-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,5-dimethylazepine-2,3-diamine?
The IUPAC name of 5,5-dimethylazepine-2,3-diamine (CID 146363123) is 5,5-dimethylazepine-2,3-diamine.
What is the SMILES notation for 5,5-dimethylazepine-2,3-diamine?
The canonical SMILES for 5,5-dimethylazepine-2,3-diamine is CC1(C)C=CN=C(N)C(N)=C1.
What is the InChIKey of 5,5-dimethylazepine-2,3-diamine?
The InChIKey is OIQCAPOTDXSGDQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13N3/c1-8(2)3-4-11-7(10)6(9)5-8/h3-5H,9H2,1-2H3,(H2,10,11).
What are the key properties of 5,5-dimethylazepine-2,3-diamine?
5,5-dimethylazepine-2,3-diamine has a molecular weight of 151.21 g/mol, XLogP of 0.74, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5,5-dimethylazepine-2,3-diamine is sourced from PubChem (CID 146363123), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).