C31H30F4N6O6 — CID 146363627
methyl N-[(E,2S)-1-[[1-[[7-[(2,4-difluorophenyl)methoxy]-4,6-difluoro-1H-benzimidazol-2-yl]methyl]-2-oxo-3-pyridinyl]amino]-7-(dimethylamino)-1,7-dioxohept-5-en-2-yl]carbamate (PubChem CID 146363627) has the molecular formula C31H30F4N6O6 and a molecular weight of 658.61 g/mol. Its IUPAC name is methyl N-[(E,2S)-1-[[1-[[7-[(2,4-difluorophenyl)methoxy]-4,6-difluoro-1H-benzimidazol-2-yl]methyl]-2-oxo-3-pyridinyl]amino]-7-(dimethylamino)-1,7-dioxohept-5-en-2-yl]carbamate.
| Compound Name | methyl N-[(E,2S)-1-[[1-[[7-[(2,4-difluorophenyl)methoxy]-4,6-difluoro-1H-benzimidazol-2-yl]methyl]-2-oxo-3-pyridinyl]amino]-7-(dimethylamino)-1,7-dioxohept-5-en-2-yl]carbamate |
|---|---|
| PubChem CID | 146363627 |
| Molecular Formula | C31H30F4N6O6 |
| Molecular Weight | 658.61 g/mol |
| Exact Mass | 658.22 |
| IUPAC Name | methyl N-[(E,2S)-1-[[1-[[7-[(2,4-difluorophenyl)methoxy]-4,6-difluoro-1H-benzimidazol-2-yl]methyl]-2-oxo-3-pyridinyl]amino]-7-(dimethylamino)-1,7-dioxohept-5-en-2-yl]carbamate |
| SMILES | COC(=O)N[C@@H](CC/C=C/C(=O)N(C)C)C(=O)Nc1cccn(Cc2nc3c(F)cc(F)c(OCc4ccc(F)cc4F)c3[nH]2)c1=O |
| InChI | InChI=1S/C31H30F4N6O6/c1-40(2)25(42)9-5-4-7-22(37-31(45)46-3)29(43)36-23-8-6-12-41(30(23)44)15-24-38-26-20(34)14-21(35)28(27(26)39-24)47-16-17-10-11-18(32)13-19(17)33/h5-6,8-14,22H,4,7,15-16H2,1-3H3,(H,36,43)(H,37,45)(H,38,39)/b9-5+/t22-/m0/s1 |
| InChIKey | RUHTZDQPBCHZQH-XPUAEESYSA-N |
| XLogP | 4.00 |
| TPSA | 147.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 47 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 658.61 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|