C21H20F3N5O2 — CID 146363986
4-[(1R)-1-(4-methoxyphenyl)ethyl]imino-1-methyl-6-(3,4,5-trifluorophenyl)-6,7-dihydroimidazo[1,2-a][1,3,5]triazin-2-one (PubChem CID 146363986) has the molecular formula C21H20F3N5O2 and a molecular weight of 431.42 g/mol. Its IUPAC name is 4-[(1R)-1-(4-methoxyphenyl)ethyl]imino-1-methyl-6-(3,4,5-trifluorophenyl)-6,7-dihydroimidazo[1,2-a][1,3,5]triazin-2-one.
| Compound Name | 4-[(1R)-1-(4-methoxyphenyl)ethyl]imino-1-methyl-6-(3,4,5-trifluorophenyl)-6,7-dihydroimidazo[1,2-a][1,3,5]triazin-2-one |
|---|---|
| PubChem CID | 146363986 |
| Molecular Formula | C21H20F3N5O2 |
| Molecular Weight | 431.42 g/mol |
| Exact Mass | 431.16 |
| IUPAC Name | 4-[(1R)-1-(4-methoxyphenyl)ethyl]imino-1-methyl-6-(3,4,5-trifluorophenyl)-6,7-dihydroimidazo[1,2-a][1,3,5]triazin-2-one |
| SMILES | COc1ccc([C@@H](C)/N=C2\NC(=O)N(C)C3=NCC(c4cc(F)c(F)c(F)c4)N32)cc1 |
| InChI | InChI=1S/C21H20F3N5O2/c1-11(12-4-6-14(31-3)7-5-12)26-19-27-21(30)28(2)20-25-10-17(29(19)20)13-8-15(22)18(24)16(23)9-13/h4-9,11,17H,10H2,1-3H3,(H,26,27,30)/t11-,17?/m1/s1 |
| InChIKey | HIMHAFKMCKUGNU-VCQTYVLVSA-N |
| XLogP | 3.60 |
| TPSA | 69.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.42 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|