C9H16O8S2 — CID 146363994
4-methyl-6-[(6-methyl-2,2-dioxo-1,3,2-dioxathian-4-yl)methyl]-1,3,2-dioxathiane 2,2-dioxide (PubChem CID 146363994) has the molecular formula C9H16O8S2 and a molecular weight of 316.35 g/mol. Its IUPAC name is 4-methyl-6-[(6-methyl-2,2-dioxo-1,3,2-dioxathian-4-yl)methyl]-1,3,2-dioxathiane 2,2-dioxide.
| Compound Name | 4-methyl-6-[(6-methyl-2,2-dioxo-1,3,2-dioxathian-4-yl)methyl]-1,3,2-dioxathiane 2,2-dioxide |
|---|---|
| PubChem CID | 146363994 |
| Molecular Formula | C9H16O8S2 |
| Molecular Weight | 316.35 g/mol |
| Exact Mass | 316.03 |
| IUPAC Name | 4-methyl-6-[(6-methyl-2,2-dioxo-1,3,2-dioxathian-4-yl)methyl]-1,3,2-dioxathiane 2,2-dioxide |
| SMILES | CC1CC(CC2CC(C)OS(=O)(=O)O2)OS(=O)(=O)O1 |
| InChI | InChI=1S/C9H16O8S2/c1-6-3-8(16-18(10,11)14-6)5-9-4-7(2)15-19(12,13)17-9/h6-9H,3-5H2,1-2H3 |
| InChIKey | HQQHYQLCQVKNTC-UHFFFAOYSA-N |
| XLogP | 0.25 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.35 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |