About (2Z)-2-ethylidene-N,5-dimethylcycloheptan-1-imine
(2Z)-2-ethylidene-N,5-dimethylcycloheptan-1-imine (PubChem CID 146364260) has the molecular formula C11H19N
and a molecular weight of 165.28 g/mol. Its IUPAC name is (2Z)-2-ethylidene-N,5-dimethylcycloheptan-1-imine.
Molecular Properties
| Compound Name | (2Z)-2-ethylidene-N,5-dimethylcycloheptan-1-imine |
| PubChem CID | 146364260 |
| Molecular Formula | C11H19N |
| Molecular Weight | 165.28 g/mol |
| Exact Mass | 165.15 |
| IUPAC Name | (2Z)-2-ethylidene-N,5-dimethylcycloheptan-1-imine |
| SMILES | C/C=C1/CCC(C)CC/C1=N\C |
| InChI | InChI=1S/C11H19N/c1-4-10-7-5-9(2)6-8-11(10)12-3/h4,9H,5-8H2,1-3H3/b10-4-,12-11+ |
| InChIKey | WKKNHYNJJQGHGG-QUBWUXJOSA-N |
| XLogP | 3.21 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 165.28 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze (2Z)-2-ethylidene-N,5-dimethylcycloheptan-1-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2Z)-2-ethylidene-N,5-dimethylcycloheptan-1-imine?
The IUPAC name of (2Z)-2-ethylidene-N,5-dimethylcycloheptan-1-imine (CID 146364260) is (2Z)-2-ethylidene-N,5-dimethylcycloheptan-1-imine.
What is the SMILES notation for (2Z)-2-ethylidene-N,5-dimethylcycloheptan-1-imine?
The canonical SMILES for (2Z)-2-ethylidene-N,5-dimethylcycloheptan-1-imine is C/C=C1/CCC(C)CC/C1=N\C.
What is the InChIKey of (2Z)-2-ethylidene-N,5-dimethylcycloheptan-1-imine?
The InChIKey is WKKNHYNJJQGHGG-QUBWUXJOSA-N. The full InChI is InChI=1S/C11H19N/c1-4-10-7-5-9(2)6-8-11(10)12-3/h4,9H,5-8H2,1-3H3/b10-4-,12-11+.
What are the key properties of (2Z)-2-ethylidene-N,5-dimethylcycloheptan-1-imine?
(2Z)-2-ethylidene-N,5-dimethylcycloheptan-1-imine has a molecular weight of 165.28 g/mol, XLogP of 3.21, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2Z)-2-ethylidene-N,5-dimethylcycloheptan-1-imine is sourced from PubChem (CID 146364260), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).