C15H20N2 — CID 146364499
(1R,4R)-2-(5,6,7,8-tetrahydronaphthalen-2-yl)-2,5-diazabicyclo[2.2.1]heptane (PubChem CID 146364499) has the molecular formula C15H20N2 and a molecular weight of 228.34 g/mol. Its IUPAC name is (1R,4R)-2-(5,6,7,8-tetrahydronaphthalen-2-yl)-2,5-diazabicyclo[2.2.1]heptane.
| Compound Name | (1R,4R)-2-(5,6,7,8-tetrahydronaphthalen-2-yl)-2,5-diazabicyclo[2.2.1]heptane |
|---|---|
| PubChem CID | 146364499 |
| Molecular Formula | C15H20N2 |
| Molecular Weight | 228.34 g/mol |
| Exact Mass | 228.16 |
| IUPAC Name | (1R,4R)-2-(5,6,7,8-tetrahydronaphthalen-2-yl)-2,5-diazabicyclo[2.2.1]heptane |
| SMILES | c1cc2c(cc1N1C[C@H]3C[C@@H]1CN3)CCCC2 |
| InChI | InChI=1S/C15H20N2/c1-2-4-12-7-14(6-5-11(12)3-1)17-10-13-8-15(17)9-16-13/h5-7,13,15-16H,1-4,8-10H2/t13-,15-/m1/s1 |
| InChIKey | JFJFKWAOVHJKPP-UKRRQHHQSA-N |
| XLogP | 2.12 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.34 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|