C17H29N — CID 146364641
N-[(1Z,3E)-2,7-dimethyl-4-(1-propylcyclopropyl)octa-1,3-dienyl]methanimine (PubChem CID 146364641) has the molecular formula C17H29N and a molecular weight of 247.43 g/mol. Its IUPAC name is N-[(1Z,3E)-2,7-dimethyl-4-(1-propylcyclopropyl)octa-1,3-dienyl]methanimine.
| Compound Name | N-[(1Z,3E)-2,7-dimethyl-4-(1-propylcyclopropyl)octa-1,3-dienyl]methanimine |
|---|---|
| PubChem CID | 146364641 |
| Molecular Formula | C17H29N |
| Molecular Weight | 247.43 g/mol |
| Exact Mass | 247.23 |
| IUPAC Name | N-[(1Z,3E)-2,7-dimethyl-4-(1-propylcyclopropyl)octa-1,3-dienyl]methanimine |
| SMILES | C=N/C=C(C)\C=C(/CCC(C)C)C1(CCC)CC1 |
| InChI | InChI=1S/C17H29N/c1-6-9-17(10-11-17)16(8-7-14(2)3)12-15(4)13-18-5/h12-14H,5-11H2,1-4H3/b15-13-,16-12+ |
| InChIKey | GPMREZXEUNFQKN-CIWNYGNPSA-N |
| XLogP | 5.53 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.43 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|