About 7-[(4-chloro-3-fluorophenyl)methyl]-4-(furan-2-yl)-2-methoxy-7H-furo[3,4-d]pyrimidin-5-one
7-[(4-chloro-3-fluorophenyl)methyl]-4-(furan-2-yl)-2-methoxy-7H-furo[3,4-d]pyrimidin-5-one (PubChem CID 146364755) has the molecular formula C18H12ClFN2O4
and a molecular weight of 374.76 g/mol. Its IUPAC name is 7-[(4-chloro-3-fluorophenyl)methyl]-4-(furan-2-yl)-2-methoxy-7H-furo[3,4-d]pyrimidin-5-one.
Molecular Properties
| Compound Name | 7-[(4-chloro-3-fluorophenyl)methyl]-4-(furan-2-yl)-2-methoxy-7H-furo[3,4-d]pyrimidin-5-one |
| PubChem CID | 146364755 |
| Molecular Formula | C18H12ClFN2O4 |
| Molecular Weight | 374.76 g/mol |
| Exact Mass | 374.05 |
| IUPAC Name | 7-[(4-chloro-3-fluorophenyl)methyl]-4-(furan-2-yl)-2-methoxy-7H-furo[3,4-d]pyrimidin-5-one |
| SMILES | COc1nc(-c2ccco2)c2c(n1)C(Cc1ccc(Cl)c(F)c1)OC2=O |
| InChI | InChI=1S/C18H12ClFN2O4/c1-24-18-21-15(12-3-2-6-25-12)14-16(22-18)13(26-17(14)23)8-9-4-5-10(19)11(20)7-9/h2-7,13H,8H2,1H3 |
| InChIKey | JXWDSFKTEGGORX-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 74.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 374.76 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 7-[(4-chloro-3-fluorophenyl)methyl]-4-(furan-2-yl)-2-methoxy-7H-furo[3,4-d]pyrimidin-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-[(4-chloro-3-fluorophenyl)methyl]-4-(furan-2-yl)-2-methoxy-7H-furo[3,4-d]pyrimidin-5-one?
The IUPAC name of 7-[(4-chloro-3-fluorophenyl)methyl]-4-(furan-2-yl)-2-methoxy-7H-furo[3,4-d]pyrimidin-5-one (CID 146364755) is 7-[(4-chloro-3-fluorophenyl)methyl]-4-(furan-2-yl)-2-methoxy-7H-furo[3,4-d]pyrimidin-5-one.
What is the SMILES notation for 7-[(4-chloro-3-fluorophenyl)methyl]-4-(furan-2-yl)-2-methoxy-7H-furo[3,4-d]pyrimidin-5-one?
The canonical SMILES for 7-[(4-chloro-3-fluorophenyl)methyl]-4-(furan-2-yl)-2-methoxy-7H-furo[3,4-d]pyrimidin-5-one is COc1nc(-c2ccco2)c2c(n1)C(Cc1ccc(Cl)c(F)c1)OC2=O.
What is the InChIKey of 7-[(4-chloro-3-fluorophenyl)methyl]-4-(furan-2-yl)-2-methoxy-7H-furo[3,4-d]pyrimidin-5-one?
The InChIKey is JXWDSFKTEGGORX-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H12ClFN2O4/c1-24-18-21-15(12-3-2-6-25-12)14-16(22-18)13(26-17(14)23)8-9-4-5-10(19)11(20)7-9/h2-7,13H,8H2,1H3.
What are the key properties of 7-[(4-chloro-3-fluorophenyl)methyl]-4-(furan-2-yl)-2-methoxy-7H-furo[3,4-d]pyrimidin-5-one?
7-[(4-chloro-3-fluorophenyl)methyl]-4-(furan-2-yl)-2-methoxy-7H-furo[3,4-d]pyrimidin-5-one has a molecular weight of 374.76 g/mol, XLogP of 3.99, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 7-[(4-chloro-3-fluorophenyl)methyl]-4-(furan-2-yl)-2-methoxy-7H-furo[3,4-d]pyrimidin-5-one is sourced from PubChem (CID 146364755), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).