C25H25FN6O5 — CID 146365710
methyl 3-[[2-[3-(4-carbamimidoylphenyl)-4,5-dihydro-1,2-oxazol-5-yl]acetyl]amino]-2-[(3-fluoro-1H-indole-2-carbonyl)amino]propanoate (PubChem CID 146365710) has the molecular formula C25H25FN6O5 and a molecular weight of 508.51 g/mol. Its IUPAC name is methyl 3-[[2-[3-(4-carbamimidoylphenyl)-4,5-dihydro-1,2-oxazol-5-yl]acetyl]amino]-2-[(3-fluoro-1H-indole-2-carbonyl)amino]propanoate.
| Compound Name | methyl 3-[[2-[3-(4-carbamimidoylphenyl)-4,5-dihydro-1,2-oxazol-5-yl]acetyl]amino]-2-[(3-fluoro-1H-indole-2-carbonyl)amino]propanoate |
|---|---|
| PubChem CID | 146365710 |
| Molecular Formula | C25H25FN6O5 |
| Molecular Weight | 508.51 g/mol |
| Exact Mass | 508.19 |
| IUPAC Name | methyl 3-[[2-[3-(4-carbamimidoylphenyl)-4,5-dihydro-1,2-oxazol-5-yl]acetyl]amino]-2-[(3-fluoro-1H-indole-2-carbonyl)amino]propanoate |
| SMILES | [H]/N=C(\N)c1ccc(C2=NOC(CC(=O)NCC(NC(=O)c3[nH]c4ccccc4c3F)C(=O)OC)C2)cc1 |
| InChI | InChI=1S/C25H25FN6O5/c1-36-25(35)19(31-24(34)22-21(26)16-4-2-3-5-17(16)30-22)12-29-20(33)11-15-10-18(32-37-15)13-6-8-14(9-7-13)23(27)28/h2-9,15,19,30H,10-12H2,1H3,(H3,27,28)(H,29,33)(H,31,34) |
| InChIKey | RVHNOUKIXNSAHI-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 171.75 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.51 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|