C26H28N6O6 — CID 146365794
methyl 3-[[2-[3-(4-carbamimidoylphenyl)-4,5-dihydro-1,2-oxazol-5-yl]acetyl]amino]-2-[[3-(hydroxymethyl)-1H-indole-2-carbonyl]amino]propanoate (PubChem CID 146365794) has the molecular formula C26H28N6O6 and a molecular weight of 520.55 g/mol. Its IUPAC name is methyl 3-[[2-[3-(4-carbamimidoylphenyl)-4,5-dihydro-1,2-oxazol-5-yl]acetyl]amino]-2-[[3-(hydroxymethyl)-1H-indole-2-carbonyl]amino]propanoate.
| Compound Name | methyl 3-[[2-[3-(4-carbamimidoylphenyl)-4,5-dihydro-1,2-oxazol-5-yl]acetyl]amino]-2-[[3-(hydroxymethyl)-1H-indole-2-carbonyl]amino]propanoate |
|---|---|
| PubChem CID | 146365794 |
| Molecular Formula | C26H28N6O6 |
| Molecular Weight | 520.55 g/mol |
| Exact Mass | 520.21 |
| IUPAC Name | methyl 3-[[2-[3-(4-carbamimidoylphenyl)-4,5-dihydro-1,2-oxazol-5-yl]acetyl]amino]-2-[[3-(hydroxymethyl)-1H-indole-2-carbonyl]amino]propanoate |
| SMILES | [H]/N=C(\N)c1ccc(C2=NOC(CC(=O)NCC(NC(=O)c3[nH]c4ccccc4c3CO)C(=O)OC)C2)cc1 |
| InChI | InChI=1S/C26H28N6O6/c1-37-26(36)21(31-25(35)23-18(13-33)17-4-2-3-5-19(17)30-23)12-29-22(34)11-16-10-20(32-38-16)14-6-8-15(9-7-14)24(27)28/h2-9,16,21,30,33H,10-13H2,1H3,(H3,27,28)(H,29,34)(H,31,35) |
| InChIKey | UGCLBXSOSJCZPH-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 191.98 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.55 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|