C30H35N7O8 — CID 146365842
methyl (3R)-2-(butoxycarbonylamino)-3-[[2-[3-(4-carbamimidoylphenyl)-4,5-dihydro-1,2-oxazol-5-yl]acetyl]amino]-3-[(3-hydroxy-1H-indole-2-carbonyl)amino]propanoate (PubChem CID 146365842) has the molecular formula C30H35N7O8 and a molecular weight of 621.65 g/mol. Its IUPAC name is methyl (3R)-2-(butoxycarbonylamino)-3-[[2-[3-(4-carbamimidoylphenyl)-4,5-dihydro-1,2-oxazol-5-yl]acetyl]amino]-3-[(3-hydroxy-1H-indole-2-carbonyl)amino]propanoate.
| Compound Name | methyl (3R)-2-(butoxycarbonylamino)-3-[[2-[3-(4-carbamimidoylphenyl)-4,5-dihydro-1,2-oxazol-5-yl]acetyl]amino]-3-[(3-hydroxy-1H-indole-2-carbonyl)amino]propanoate |
|---|---|
| PubChem CID | 146365842 |
| Molecular Formula | C30H35N7O8 |
| Molecular Weight | 621.65 g/mol |
| Exact Mass | 621.25 |
| IUPAC Name | methyl (3R)-2-(butoxycarbonylamino)-3-[[2-[3-(4-carbamimidoylphenyl)-4,5-dihydro-1,2-oxazol-5-yl]acetyl]amino]-3-[(3-hydroxy-1H-indole-2-carbonyl)amino]propanoate |
| SMILES | [H]/N=C(\N)c1ccc(C2=NOC(CC(=O)N[C@H](NC(=O)c3[nH]c4ccccc4c3O)C(NC(=O)OCCCC)C(=O)OC)C2)cc1 |
| InChI | InChI=1S/C30H35N7O8/c1-3-4-13-44-30(42)35-24(29(41)43-2)27(36-28(40)23-25(39)19-7-5-6-8-20(19)33-23)34-22(38)15-18-14-21(37-45-18)16-9-11-17(12-10-16)26(31)32/h5-12,18,24,27,33,39H,3-4,13-15H2,1-2H3,(H3,31,32)(H,34,38)(H,35,42)(H,36,40)/t18?,24?,27-/m1/s1 |
| InChIKey | WEBOWZKQVYHMPR-PDKDFQAWSA-N |
| XLogP | 1.98 |
| TPSA | 230.31 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 621.65 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|