C13H15I2NO5S — CID 146365891
2-(1,1-dioxo-1,4-thiazinan-4-yl)ethyl 2-hydroxy-3,5-diiodobenzoate (PubChem CID 146365891) has the molecular formula C13H15I2NO5S and a molecular weight of 551.14 g/mol. Its IUPAC name is 2-(1,1-dioxo-1,4-thiazinan-4-yl)ethyl 2-hydroxy-3,5-diiodobenzoate.
| Compound Name | 2-(1,1-dioxo-1,4-thiazinan-4-yl)ethyl 2-hydroxy-3,5-diiodobenzoate |
|---|---|
| PubChem CID | 146365891 |
| Molecular Formula | C13H15I2NO5S |
| Molecular Weight | 551.14 g/mol |
| Exact Mass | 550.88 |
| IUPAC Name | 2-(1,1-dioxo-1,4-thiazinan-4-yl)ethyl 2-hydroxy-3,5-diiodobenzoate |
| SMILES | O=C(OCCN1CCS(=O)(=O)CC1)c1cc(I)cc(I)c1O |
| InChI | InChI=1S/C13H15I2NO5S/c14-9-7-10(12(17)11(15)8-9)13(18)21-4-1-16-2-5-22(19,20)6-3-16/h7-8,17H,1-6H2 |
| InChIKey | SNYYUCVUDQOFQE-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.14 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|