C30H34FN7O7 — CID 146366060
methyl (3R)-2-(butoxycarbonylamino)-3-[[2-[3-(4-carbamimidoylphenyl)-4,5-dihydro-1,2-oxazol-5-yl]acetyl]amino]-3-[(3-fluoro-1H-indole-2-carbonyl)amino]propanoate (PubChem CID 146366060) has the molecular formula C30H34FN7O7 and a molecular weight of 623.64 g/mol. Its IUPAC name is methyl (3R)-2-(butoxycarbonylamino)-3-[[2-[3-(4-carbamimidoylphenyl)-4,5-dihydro-1,2-oxazol-5-yl]acetyl]amino]-3-[(3-fluoro-1H-indole-2-carbonyl)amino]propanoate.
| Compound Name | methyl (3R)-2-(butoxycarbonylamino)-3-[[2-[3-(4-carbamimidoylphenyl)-4,5-dihydro-1,2-oxazol-5-yl]acetyl]amino]-3-[(3-fluoro-1H-indole-2-carbonyl)amino]propanoate |
|---|---|
| PubChem CID | 146366060 |
| Molecular Formula | C30H34FN7O7 |
| Molecular Weight | 623.64 g/mol |
| Exact Mass | 623.25 |
| IUPAC Name | methyl (3R)-2-(butoxycarbonylamino)-3-[[2-[3-(4-carbamimidoylphenyl)-4,5-dihydro-1,2-oxazol-5-yl]acetyl]amino]-3-[(3-fluoro-1H-indole-2-carbonyl)amino]propanoate |
| SMILES | [H]/N=C(\N)c1ccc(C2=NOC(CC(=O)N[C@H](NC(=O)c3[nH]c4ccccc4c3F)C(NC(=O)OCCCC)C(=O)OC)C2)cc1 |
| InChI | InChI=1S/C30H34FN7O7/c1-3-4-13-44-30(42)36-25(29(41)43-2)27(37-28(40)24-23(31)19-7-5-6-8-20(19)34-24)35-22(39)15-18-14-21(38-45-18)16-9-11-17(12-10-16)26(32)33/h5-12,18,25,27,34H,3-4,13-15H2,1-2H3,(H3,32,33)(H,35,39)(H,36,42)(H,37,40)/t18?,25?,27-/m1/s1 |
| InChIKey | KYVSCJSKQDLETC-IOZWRJRUSA-N |
| XLogP | 2.41 |
| TPSA | 210.08 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 623.64 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|