C15H20O5 — CID 146366363
(2R,4S,4aR,8R,8aR)-8-hydroxy-7-(hydroxymethyl)-4-methyl-3'-methylidenespiro[3,4,4a,5,8,8a-hexahydrochromene-2,5'-oxolane]-2'-one (PubChem CID 146366363) has the molecular formula C15H20O5 and a molecular weight of 280.32 g/mol. Its IUPAC name is (2R,4S,4aR,8R,8aR)-8-hydroxy-7-(hydroxymethyl)-4-methyl-3'-methylidenespiro[3,4,4a,5,8,8a-hexahydrochromene-2,5'-oxolane]-2'-one.
| Compound Name | (2R,4S,4aR,8R,8aR)-8-hydroxy-7-(hydroxymethyl)-4-methyl-3'-methylidenespiro[3,4,4a,5,8,8a-hexahydrochromene-2,5'-oxolane]-2'-one |
|---|---|
| PubChem CID | 146366363 |
| Molecular Formula | C15H20O5 |
| Molecular Weight | 280.32 g/mol |
| Exact Mass | 280.13 |
| IUPAC Name | (2R,4S,4aR,8R,8aR)-8-hydroxy-7-(hydroxymethyl)-4-methyl-3'-methylidenespiro[3,4,4a,5,8,8a-hexahydrochromene-2,5'-oxolane]-2'-one |
| SMILES | C=C1C[C@@]2(C[C@H](C)[C@H]3CC=C(CO)[C@@H](O)[C@@H]3O2)OC1=O |
| InChI | InChI=1S/C15H20O5/c1-8-5-15(6-9(2)14(18)20-15)19-13-11(8)4-3-10(7-16)12(13)17/h3,8,11-13,16-17H,2,4-7H2,1H3/t8-,11+,12+,13+,15+/m0/s1 |
| InChIKey | WKECUUNGCZXKIV-RPMKOLLGSA-N |
| XLogP | 0.91 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.32 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|