C32H48N4O12 — CID 146366430
dimethyl 2-[3,9-bis(1,5-dimethoxy-1,5-dioxopentan-2-yl)-3,6,9,15-tetrazabicyclo[9.3.1]pentadeca-1(15),11,13-trien-6-yl]pentanedioate (PubChem CID 146366430) has the molecular formula C32H48N4O12 and a molecular weight of 680.75 g/mol. Its IUPAC name is dimethyl 2-[3,9-bis(1,5-dimethoxy-1,5-dioxopentan-2-yl)-3,6,9,15-tetrazabicyclo[9.3.1]pentadeca-1(15),11,13-trien-6-yl]pentanedioate.
| Compound Name | dimethyl 2-[3,9-bis(1,5-dimethoxy-1,5-dioxopentan-2-yl)-3,6,9,15-tetrazabicyclo[9.3.1]pentadeca-1(15),11,13-trien-6-yl]pentanedioate |
|---|---|
| PubChem CID | 146366430 |
| Molecular Formula | C32H48N4O12 |
| Molecular Weight | 680.75 g/mol |
| Exact Mass | 680.33 |
| IUPAC Name | dimethyl 2-[3,9-bis(1,5-dimethoxy-1,5-dioxopentan-2-yl)-3,6,9,15-tetrazabicyclo[9.3.1]pentadeca-1(15),11,13-trien-6-yl]pentanedioate |
| SMILES | COC(=O)CCC(C(=O)OC)N1CCN(C(CCC(=O)OC)C(=O)OC)Cc2cccc(n2)CN(C(CCC(=O)OC)C(=O)OC)CC1 |
| InChI | InChI=1S/C32H48N4O12/c1-43-27(37)13-10-24(30(40)46-4)34-16-18-35(25(31(41)47-5)11-14-28(38)44-2)20-22-8-7-9-23(33-22)21-36(19-17-34)26(32(42)48-6)12-15-29(39)45-3/h7-9,24-26H,10-21H2,1-6H3 |
| InChIKey | HZMJLUADDZQEQE-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 180.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 680.75 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|