C22H21N7O2 — CID 146366806
5-[2-(2,3-dimethylimidazol-4-yl)ethynyl]-15-methoxy-9-(methoxymethyl)-2,4,8,10,11-pentazatetracyclo[11.4.0.02,6.08,12]heptadeca-1(13),3,5,9,11,14,16-heptaene (PubChem CID 146366806) has the molecular formula C22H21N7O2 and a molecular weight of 415.46 g/mol. Its IUPAC name is 5-[2-(2,3-dimethylimidazol-4-yl)ethynyl]-15-methoxy-9-(methoxymethyl)-2,4,8,10,11-pentazatetracyclo[11.4.0.02,6.08,12]heptadeca-1(13),3,5,9,11,14,16-heptaene.
| Compound Name | 5-[2-(2,3-dimethylimidazol-4-yl)ethynyl]-15-methoxy-9-(methoxymethyl)-2,4,8,10,11-pentazatetracyclo[11.4.0.02,6.08,12]heptadeca-1(13),3,5,9,11,14,16-heptaene |
|---|---|
| PubChem CID | 146366806 |
| Molecular Formula | C22H21N7O2 |
| Molecular Weight | 415.46 g/mol |
| Exact Mass | 415.18 |
| IUPAC Name | 5-[2-(2,3-dimethylimidazol-4-yl)ethynyl]-15-methoxy-9-(methoxymethyl)-2,4,8,10,11-pentazatetracyclo[11.4.0.02,6.08,12]heptadeca-1(13),3,5,9,11,14,16-heptaene |
| SMILES | COCc1nnc2n1Cc1c(C#Cc3cnc(C)n3C)ncn1-c1ccc(OC)cc1-2 |
| InChI | InChI=1S/C22H21N7O2/c1-14-23-10-15(27(14)2)5-7-18-20-11-28-21(12-30-3)25-26-22(28)17-9-16(31-4)6-8-19(17)29(20)13-24-18/h6,8-10,13H,11-12H2,1-4H3 |
| InChIKey | NQENHYCJKWFHGB-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 84.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.46 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|