C22H17ClN6O2 — CID 146366922
5-[2-[15-chloro-9-(methoxymethyl)-2,4,8,10,11-pentazatetracyclo[11.4.0.02,6.08,12]heptadeca-1(13),3,5,9,11,14,16-heptaen-5-yl]ethynyl]-1-methylpyridin-2-one (PubChem CID 146366922) has the molecular formula C22H17ClN6O2 and a molecular weight of 432.87 g/mol. Its IUPAC name is 5-[2-[15-chloro-9-(methoxymethyl)-2,4,8,10,11-pentazatetracyclo[11.4.0.02,6.08,12]heptadeca-1(13),3,5,9,11,14,16-heptaen-5-yl]ethynyl]-1-methylpyridin-2-one.
| Compound Name | 5-[2-[15-chloro-9-(methoxymethyl)-2,4,8,10,11-pentazatetracyclo[11.4.0.02,6.08,12]heptadeca-1(13),3,5,9,11,14,16-heptaen-5-yl]ethynyl]-1-methylpyridin-2-one |
|---|---|
| PubChem CID | 146366922 |
| Molecular Formula | C22H17ClN6O2 |
| Molecular Weight | 432.87 g/mol |
| Exact Mass | 432.11 |
| IUPAC Name | 5-[2-[15-chloro-9-(methoxymethyl)-2,4,8,10,11-pentazatetracyclo[11.4.0.02,6.08,12]heptadeca-1(13),3,5,9,11,14,16-heptaen-5-yl]ethynyl]-1-methylpyridin-2-one |
| SMILES | COCc1nnc2n1Cc1c(C#Cc3ccc(=O)n(C)c3)ncn1-c1ccc(Cl)cc1-2 |
| InChI | InChI=1S/C22H17ClN6O2/c1-27-10-14(4-8-21(27)30)3-6-17-19-11-28-20(12-31-2)25-26-22(28)16-9-15(23)5-7-18(16)29(19)13-24-17/h4-5,7-10,13H,11-12H2,1-2H3 |
| InChIKey | VZRXFNKQNYFQTJ-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 79.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.87 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|