C38H52O6 — CID 146366959
2-[[(3S,6bS,8aS,11R,12S,12aS,14bR)-8a-methoxycarbonyl-4,4,6b,11,12,14b-hexamethyl-1,2,3,4a,5,6,6a,7,8,9,10,11,12,12a,14,14a-hexadecahydropicen-3-yl]oxycarbonyl]benzoic acid (PubChem CID 146366959) has the molecular formula C38H52O6 and a molecular weight of 604.83 g/mol. Its IUPAC name is 2-[[(3S,6bS,8aS,11R,12S,12aS,14bR)-8a-methoxycarbonyl-4,4,6b,11,12,14b-hexamethyl-1,2,3,4a,5,6,6a,7,8,9,10,11,12,12a,14,14a-hexadecahydropicen-3-yl]oxycarbonyl]benzoic acid.
| Compound Name | 2-[[(3S,6bS,8aS,11R,12S,12aS,14bR)-8a-methoxycarbonyl-4,4,6b,11,12,14b-hexamethyl-1,2,3,4a,5,6,6a,7,8,9,10,11,12,12a,14,14a-hexadecahydropicen-3-yl]oxycarbonyl]benzoic acid |
|---|---|
| PubChem CID | 146366959 |
| Molecular Formula | C38H52O6 |
| Molecular Weight | 604.83 g/mol |
| Exact Mass | 604.38 |
| IUPAC Name | 2-[[(3S,6bS,8aS,11R,12S,12aS,14bR)-8a-methoxycarbonyl-4,4,6b,11,12,14b-hexamethyl-1,2,3,4a,5,6,6a,7,8,9,10,11,12,12a,14,14a-hexadecahydropicen-3-yl]oxycarbonyl]benzoic acid |
| SMILES | COC(=O)[C@]12CC[C@@H](C)[C@H](C)[C@H]1C1=CCC3C(CCC4C(C)(C)[C@@H](OC(=O)c5ccccc5C(=O)O)CC[C@]34C)[C@]1(C)CC2 |
| InChI | InChI=1S/C38H52O6/c1-22-16-19-38(34(42)43-7)21-20-36(5)26-14-15-29-35(3,4)30(44-33(41)25-11-9-8-10-24(25)32(39)40)17-18-37(29,6)27(26)12-13-28(36)31(38)23(22)2/h8-11,13,22-23,26-27,29-31H,12,14-21H2,1-7H3,(H,39,40)/t22-,23+,26?,27?,29?,30+,31+,36+,37-,38+/m1/s1 |
| InChIKey | JGIDVQSRQIYKFA-MEKFCMSLSA-N |
| XLogP | 8.35 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.83 |
| LogP ≤ 5 | 8.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|