About (3E)-8-ethyl-4-(ethylideneamino)-2-iminodeca-3,9-dien-3-amine
(3E)-8-ethyl-4-(ethylideneamino)-2-iminodeca-3,9-dien-3-amine (PubChem CID 146366972) has the molecular formula C14H25N3
and a molecular weight of 235.38 g/mol. Its IUPAC name is (3E)-8-ethyl-4-(ethylideneamino)-2-iminodeca-3,9-dien-3-amine.
Molecular Properties
| Compound Name | (3E)-8-ethyl-4-(ethylideneamino)-2-iminodeca-3,9-dien-3-amine |
| PubChem CID | 146366972 |
| Molecular Formula | C14H25N3 |
| Molecular Weight | 235.38 g/mol |
| Exact Mass | 235.20 |
| IUPAC Name | (3E)-8-ethyl-4-(ethylideneamino)-2-iminodeca-3,9-dien-3-amine |
| SMILES | [H]/N=C(C)/C(N)=C(CCCC(C=C)CC)\N=C\C |
| InChI | InChI=1S/C14H25N3/c1-5-12(6-2)9-8-10-13(17-7-3)14(16)11(4)15/h5,7,12,15H,1,6,8-10,16H2,2-4H3/b14-13+,15-11+,17-7+ |
| InChIKey | CRUCVHHQSOOEHS-INPDXVKYSA-N |
| XLogP | 3.67 |
| TPSA | 62.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 235.38 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (3E)-8-ethyl-4-(ethylideneamino)-2-iminodeca-3,9-dien-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3E)-8-ethyl-4-(ethylideneamino)-2-iminodeca-3,9-dien-3-amine?
The IUPAC name of (3E)-8-ethyl-4-(ethylideneamino)-2-iminodeca-3,9-dien-3-amine (CID 146366972) is (3E)-8-ethyl-4-(ethylideneamino)-2-iminodeca-3,9-dien-3-amine.
What is the SMILES notation for (3E)-8-ethyl-4-(ethylideneamino)-2-iminodeca-3,9-dien-3-amine?
The canonical SMILES for (3E)-8-ethyl-4-(ethylideneamino)-2-iminodeca-3,9-dien-3-amine is [H]/N=C(C)/C(N)=C(CCCC(C=C)CC)\N=C\C.
What is the InChIKey of (3E)-8-ethyl-4-(ethylideneamino)-2-iminodeca-3,9-dien-3-amine?
The InChIKey is CRUCVHHQSOOEHS-INPDXVKYSA-N. The full InChI is InChI=1S/C14H25N3/c1-5-12(6-2)9-8-10-13(17-7-3)14(16)11(4)15/h5,7,12,15H,1,6,8-10,16H2,2-4H3/b14-13+,15-11+,17-7+.
What are the key properties of (3E)-8-ethyl-4-(ethylideneamino)-2-iminodeca-3,9-dien-3-amine?
(3E)-8-ethyl-4-(ethylideneamino)-2-iminodeca-3,9-dien-3-amine has a molecular weight of 235.38 g/mol, XLogP of 3.67, 8 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3E)-8-ethyl-4-(ethylideneamino)-2-iminodeca-3,9-dien-3-amine is sourced from PubChem (CID 146366972), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).