C26H32FN7O2 — CID 146367099
7-fluoro-4-[4-(4-methylpiperazin-1-yl)anilino]-6-[(1-prop-2-enoylpiperidin-3-yl)amino]-1,2-dihydropyrrolo[3,4-c]pyridin-3-one (PubChem CID 146367099) has the molecular formula C26H32FN7O2 and a molecular weight of 493.59 g/mol. Its IUPAC name is 7-fluoro-4-[4-(4-methylpiperazin-1-yl)anilino]-6-[(1-prop-2-enoylpiperidin-3-yl)amino]-1,2-dihydropyrrolo[3,4-c]pyridin-3-one.
| Compound Name | 7-fluoro-4-[4-(4-methylpiperazin-1-yl)anilino]-6-[(1-prop-2-enoylpiperidin-3-yl)amino]-1,2-dihydropyrrolo[3,4-c]pyridin-3-one |
|---|---|
| PubChem CID | 146367099 |
| Molecular Formula | C26H32FN7O2 |
| Molecular Weight | 493.59 g/mol |
| Exact Mass | 493.26 |
| IUPAC Name | 7-fluoro-4-[4-(4-methylpiperazin-1-yl)anilino]-6-[(1-prop-2-enoylpiperidin-3-yl)amino]-1,2-dihydropyrrolo[3,4-c]pyridin-3-one |
| SMILES | C=CC(=O)N1CCCC(Nc2nc(Nc3ccc(N4CCN(C)CC4)cc3)c3c(c2F)CNC3=O)C1 |
| InChI | InChI=1S/C26H32FN7O2/c1-3-21(35)34-10-4-5-18(16-34)30-25-23(27)20-15-28-26(36)22(20)24(31-25)29-17-6-8-19(9-7-17)33-13-11-32(2)12-14-33/h3,6-9,18H,1,4-5,10-16H2,2H3,(H,28,36)(H2,29,30,31) |
| InChIKey | UBLPYHLEUUMUAO-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 92.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.59 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|