C14H23N3 — CID 146367196
(3E)-7-ethyl-4-(ethylideneamino)-2-imino-6-methylnona-3,7,8-trien-3-amine (PubChem CID 146367196) has the molecular formula C14H23N3 and a molecular weight of 233.36 g/mol. Its IUPAC name is (3E)-7-ethyl-4-(ethylideneamino)-2-imino-6-methylnona-3,7,8-trien-3-amine.
| Compound Name | (3E)-7-ethyl-4-(ethylideneamino)-2-imino-6-methylnona-3,7,8-trien-3-amine |
|---|---|
| PubChem CID | 146367196 |
| Molecular Formula | C14H23N3 |
| Molecular Weight | 233.36 g/mol |
| Exact Mass | 233.19 |
| IUPAC Name | (3E)-7-ethyl-4-(ethylideneamino)-2-imino-6-methylnona-3,7,8-trien-3-amine |
| SMILES | [H]/N=C(C)/C(N)=C(CC(C)C(=C=C)CC)\N=C\C |
| InChI | InChI=1S/C14H23N3/c1-6-12(7-2)10(4)9-13(17-8-3)14(16)11(5)15/h8,10,15H,1,7,9,16H2,2-5H3/b14-13+,15-11+,17-8+ |
| InChIKey | BLPXVBSBKJOCJV-AWAOPURXSA-N |
| XLogP | 3.43 |
| TPSA | 62.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.36 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|