About 4-tert-butyl-1-(4,4-difluorocyclohexyl)pyrazole
4-tert-butyl-1-(4,4-difluorocyclohexyl)pyrazole (PubChem CID 146367376) has the molecular formula C13H20F2N2
and a molecular weight of 242.31 g/mol. Its IUPAC name is 4-tert-butyl-1-(4,4-difluorocyclohexyl)pyrazole.
Molecular Properties
| Compound Name | 4-tert-butyl-1-(4,4-difluorocyclohexyl)pyrazole |
| PubChem CID | 146367376 |
| Molecular Formula | C13H20F2N2 |
| Molecular Weight | 242.31 g/mol |
| Exact Mass | 242.16 |
| IUPAC Name | 4-tert-butyl-1-(4,4-difluorocyclohexyl)pyrazole |
| SMILES | CC(C)(C)c1cnn(C2CCC(F)(F)CC2)c1 |
| InChI | InChI=1S/C13H20F2N2/c1-12(2,3)10-8-16-17(9-10)11-4-6-13(14,15)7-5-11/h8-9,11H,4-7H2,1-3H3 |
| InChIKey | MJPKXRZAZXXIAL-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.31 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-tert-butyl-1-(4,4-difluorocyclohexyl)pyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-tert-butyl-1-(4,4-difluorocyclohexyl)pyrazole?
The IUPAC name of 4-tert-butyl-1-(4,4-difluorocyclohexyl)pyrazole (CID 146367376) is 4-tert-butyl-1-(4,4-difluorocyclohexyl)pyrazole.
What is the SMILES notation for 4-tert-butyl-1-(4,4-difluorocyclohexyl)pyrazole?
The canonical SMILES for 4-tert-butyl-1-(4,4-difluorocyclohexyl)pyrazole is CC(C)(C)c1cnn(C2CCC(F)(F)CC2)c1.
What is the InChIKey of 4-tert-butyl-1-(4,4-difluorocyclohexyl)pyrazole?
The InChIKey is MJPKXRZAZXXIAL-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H20F2N2/c1-12(2,3)10-8-16-17(9-10)11-4-6-13(14,15)7-5-11/h8-9,11H,4-7H2,1-3H3.
What are the key properties of 4-tert-butyl-1-(4,4-difluorocyclohexyl)pyrazole?
4-tert-butyl-1-(4,4-difluorocyclohexyl)pyrazole has a molecular weight of 242.31 g/mol, XLogP of 3.93, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-tert-butyl-1-(4,4-difluorocyclohexyl)pyrazole is sourced from PubChem (CID 146367376), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).