C62H41N5 — CID 146367748
2-[4-[2-(4,6-diphenylpyrimidin-2-yl)-9,9-diphenylfluoren-3-yl]phenyl]-4,6-diphenyl-1,3,5-triazine (PubChem CID 146367748) has the molecular formula C62H41N5 and a molecular weight of 856.05 g/mol. Its IUPAC name is 2-[4-[2-(4,6-diphenylpyrimidin-2-yl)-9,9-diphenylfluoren-3-yl]phenyl]-4,6-diphenyl-1,3,5-triazine.
| Compound Name | 2-[4-[2-(4,6-diphenylpyrimidin-2-yl)-9,9-diphenylfluoren-3-yl]phenyl]-4,6-diphenyl-1,3,5-triazine |
|---|---|
| PubChem CID | 146367748 |
| Molecular Formula | C62H41N5 |
| Molecular Weight | 856.05 g/mol |
| Exact Mass | 855.34 |
| IUPAC Name | 2-[4-[2-(4,6-diphenylpyrimidin-2-yl)-9,9-diphenylfluoren-3-yl]phenyl]-4,6-diphenyl-1,3,5-triazine |
| SMILES | c1ccc(-c2cc(-c3ccccc3)nc(-c3cc4c(cc3-c3ccc(-c5nc(-c6ccccc6)nc(-c6ccccc6)n5)cc3)-c3ccccc3C4(c3ccccc3)c3ccccc3)n2)cc1 |
| InChI | InChI=1S/C62H41N5/c1-7-21-43(22-8-1)56-41-57(44-23-9-2-10-24-44)64-61(63-56)53-40-55-52(50-33-19-20-34-54(50)62(55,48-29-15-5-16-30-48)49-31-17-6-18-32-49)39-51(53)42-35-37-47(38-36-42)60-66-58(45-25-11-3-12-26-45)65-59(67-60)46-27-13-4-14-28-46/h1-41H |
| InChIKey | QFULXORQKYFMII-UHFFFAOYSA-N |
| XLogP | 14.69 |
| TPSA | 64.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 67 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 856.05 |
| LogP ≤ 5 | 14.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |