About 2-(7-ethynyl-2,2-dimethyl-1,3-benzodioxol-5-yl)-2-prop-2-ynoxyethanamine
2-(7-ethynyl-2,2-dimethyl-1,3-benzodioxol-5-yl)-2-prop-2-ynoxyethanamine (PubChem CID 146368687) has the molecular formula C16H17NO3
and a molecular weight of 271.32 g/mol. Its IUPAC name is 2-(7-ethynyl-2,2-dimethyl-1,3-benzodioxol-5-yl)-2-prop-2-ynoxyethanamine.
Molecular Properties
| Compound Name | 2-(7-ethynyl-2,2-dimethyl-1,3-benzodioxol-5-yl)-2-prop-2-ynoxyethanamine |
| PubChem CID | 146368687 |
| Molecular Formula | C16H17NO3 |
| Molecular Weight | 271.32 g/mol |
| Exact Mass | 271.12 |
| IUPAC Name | 2-(7-ethynyl-2,2-dimethyl-1,3-benzodioxol-5-yl)-2-prop-2-ynoxyethanamine |
| SMILES | C#CCOC(CN)c1cc(C#C)c2c(c1)OC(C)(C)O2 |
| InChI | InChI=1S/C16H17NO3/c1-5-7-18-14(10-17)12-8-11(6-2)15-13(9-12)19-16(3,4)20-15/h1-2,8-9,14H,7,10,17H2,3-4H3 |
| InChIKey | PHLWHNGFLWVDNS-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 53.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 271.32 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-(7-ethynyl-2,2-dimethyl-1,3-benzodioxol-5-yl)-2-prop-2-ynoxyethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(7-ethynyl-2,2-dimethyl-1,3-benzodioxol-5-yl)-2-prop-2-ynoxyethanamine?
The IUPAC name of 2-(7-ethynyl-2,2-dimethyl-1,3-benzodioxol-5-yl)-2-prop-2-ynoxyethanamine (CID 146368687) is 2-(7-ethynyl-2,2-dimethyl-1,3-benzodioxol-5-yl)-2-prop-2-ynoxyethanamine.
What is the SMILES notation for 2-(7-ethynyl-2,2-dimethyl-1,3-benzodioxol-5-yl)-2-prop-2-ynoxyethanamine?
The canonical SMILES for 2-(7-ethynyl-2,2-dimethyl-1,3-benzodioxol-5-yl)-2-prop-2-ynoxyethanamine is C#CCOC(CN)c1cc(C#C)c2c(c1)OC(C)(C)O2.
What is the InChIKey of 2-(7-ethynyl-2,2-dimethyl-1,3-benzodioxol-5-yl)-2-prop-2-ynoxyethanamine?
The InChIKey is PHLWHNGFLWVDNS-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H17NO3/c1-5-7-18-14(10-17)12-8-11(6-2)15-13(9-12)19-16(3,4)20-15/h1-2,8-9,14H,7,10,17H2,3-4H3.
What are the key properties of 2-(7-ethynyl-2,2-dimethyl-1,3-benzodioxol-5-yl)-2-prop-2-ynoxyethanamine?
2-(7-ethynyl-2,2-dimethyl-1,3-benzodioxol-5-yl)-2-prop-2-ynoxyethanamine has a molecular weight of 271.32 g/mol, XLogP of 1.82, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(7-ethynyl-2,2-dimethyl-1,3-benzodioxol-5-yl)-2-prop-2-ynoxyethanamine is sourced from PubChem (CID 146368687), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).