C12H23N3 — CID 146369451
(1Z,3Z)-5-ethyl-3-methanimidoyl-6,6-dimethylhepta-1,3-diene-1,4-diamine (PubChem CID 146369451) has the molecular formula C12H23N3 and a molecular weight of 209.34 g/mol. Its IUPAC name is (1Z,3Z)-5-ethyl-3-methanimidoyl-6,6-dimethylhepta-1,3-diene-1,4-diamine.
| Compound Name | (1Z,3Z)-5-ethyl-3-methanimidoyl-6,6-dimethylhepta-1,3-diene-1,4-diamine |
|---|---|
| PubChem CID | 146369451 |
| Molecular Formula | C12H23N3 |
| Molecular Weight | 209.34 g/mol |
| Exact Mass | 209.19 |
| IUPAC Name | (1Z,3Z)-5-ethyl-3-methanimidoyl-6,6-dimethylhepta-1,3-diene-1,4-diamine |
| SMILES | [H]/N=C/C(/C=C\N)=C(\N)C(CC)C(C)(C)C |
| InChI | InChI=1S/C12H23N3/c1-5-10(12(2,3)4)11(15)9(8-14)6-7-13/h6-8,10,14H,5,13,15H2,1-4H3/b7-6-,11-9-,14-8+ |
| InChIKey | SNXOSXFMHNRCPP-QYKBJUBCSA-N |
| XLogP | 2.39 |
| TPSA | 75.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.34 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|