C26H23N7O3 — CID 146369455
[2-[[4-[8-amino-3-[(2S)-pyrrolidin-2-yl]imidazo[1,5-a]pyrazin-1-yl]benzoyl]amino]-4-pyridinyl] but-2-ynoate (PubChem CID 146369455) has the molecular formula C26H23N7O3 and a molecular weight of 481.52 g/mol. Its IUPAC name is [2-[[4-[8-amino-3-[(2S)-pyrrolidin-2-yl]imidazo[1,5-a]pyrazin-1-yl]benzoyl]amino]-4-pyridinyl] but-2-ynoate.
| Compound Name | [2-[[4-[8-amino-3-[(2S)-pyrrolidin-2-yl]imidazo[1,5-a]pyrazin-1-yl]benzoyl]amino]-4-pyridinyl] but-2-ynoate |
|---|---|
| PubChem CID | 146369455 |
| Molecular Formula | C26H23N7O3 |
| Molecular Weight | 481.52 g/mol |
| Exact Mass | 481.19 |
| IUPAC Name | [2-[[4-[8-amino-3-[(2S)-pyrrolidin-2-yl]imidazo[1,5-a]pyrazin-1-yl]benzoyl]amino]-4-pyridinyl] but-2-ynoate |
| SMILES | CC#CC(=O)Oc1ccnc(NC(=O)c2ccc(-c3nc([C@@H]4CCCN4)n4ccnc(N)c34)cc2)c1 |
| InChI | InChI=1S/C26H23N7O3/c1-2-4-21(34)36-18-10-12-29-20(15-18)31-26(35)17-8-6-16(7-9-17)22-23-24(27)30-13-14-33(23)25(32-22)19-5-3-11-28-19/h6-10,12-15,19,28H,3,5,11H2,1H3,(H2,27,30)(H,29,31,35)/t19-/m0/s1 |
| InChIKey | BVZJZVJVVHINAG-IBGZPJMESA-N |
| XLogP | 2.98 |
| TPSA | 136.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.52 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_5', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|