C22H23F3N6 — CID 146369753
N-[(Z)-[(3S,4R)-3-[5-(difluoromethyl)-[1,2,4]triazolo[1,5-a]pyrimidin-7-yl]-4-methylpiperidin-1-yl]-[(6Z)-6-ethylidene-3-fluorocyclohexa-2,4-dien-1-ylidene]methyl]methanimine (PubChem CID 146369753) has the molecular formula C22H23F3N6 and a molecular weight of 428.46 g/mol. Its IUPAC name is N-[(Z)-[(3S,4R)-3-[5-(difluoromethyl)-[1,2,4]triazolo[1,5-a]pyrimidin-7-yl]-4-methylpiperidin-1-yl]-[(6Z)-6-ethylidene-3-fluorocyclohexa-2,4-dien-1-ylidene]methyl]methanimine.
| Compound Name | N-[(Z)-[(3S,4R)-3-[5-(difluoromethyl)-[1,2,4]triazolo[1,5-a]pyrimidin-7-yl]-4-methylpiperidin-1-yl]-[(6Z)-6-ethylidene-3-fluorocyclohexa-2,4-dien-1-ylidene]methyl]methanimine |
|---|---|
| PubChem CID | 146369753 |
| Molecular Formula | C22H23F3N6 |
| Molecular Weight | 428.46 g/mol |
| Exact Mass | 428.19 |
| IUPAC Name | N-[(Z)-[(3S,4R)-3-[5-(difluoromethyl)-[1,2,4]triazolo[1,5-a]pyrimidin-7-yl]-4-methylpiperidin-1-yl]-[(6Z)-6-ethylidene-3-fluorocyclohexa-2,4-dien-1-ylidene]methyl]methanimine |
| SMILES | C=N/C(=c1/cc(F)cc/c1=C/C)N1CC[C@@H](C)[C@H](c2cc(C(F)F)nc3ncnn23)C1 |
| InChI | InChI=1S/C22H23F3N6/c1-4-14-5-6-15(23)9-16(14)21(26-3)30-8-7-13(2)17(11-30)19-10-18(20(24)25)29-22-27-12-28-31(19)22/h4-6,9-10,12-13,17,20H,3,7-8,11H2,1-2H3/b14-4-,21-16+/t13-,17-/m1/s1 |
| InChIKey | WIBDQOOSRSWRBW-SVMPDZAFSA-N |
| XLogP | 2.89 |
| TPSA | 58.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.46 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|