About N-[(Z)-(4-ethenyl-1,5-dimethyl-2,3-dihydropyridin-6-ylidene)methyl]methanimine
N-[(Z)-(4-ethenyl-1,5-dimethyl-2,3-dihydropyridin-6-ylidene)methyl]methanimine (PubChem CID 146370264) has the molecular formula C11H16N2
and a molecular weight of 176.26 g/mol. Its IUPAC name is N-[(Z)-(4-ethenyl-1,5-dimethyl-2,3-dihydropyridin-6-ylidene)methyl]methanimine.
Molecular Properties
| Compound Name | N-[(Z)-(4-ethenyl-1,5-dimethyl-2,3-dihydropyridin-6-ylidene)methyl]methanimine |
| PubChem CID | 146370264 |
| Molecular Formula | C11H16N2 |
| Molecular Weight | 176.26 g/mol |
| Exact Mass | 176.13 |
| IUPAC Name | N-[(Z)-(4-ethenyl-1,5-dimethyl-2,3-dihydropyridin-6-ylidene)methyl]methanimine |
| SMILES | C=CC1=C(C)/C(=C/N=C)N(C)CC1 |
| InChI | InChI=1S/C11H16N2/c1-5-10-6-7-13(4)11(8-12-3)9(10)2/h5,8H,1,3,6-7H2,2,4H3/b11-8- |
| InChIKey | NBTRRHUCBCZWCY-FLIBITNWSA-N |
| XLogP | 2.37 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 176.26 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze N-[(Z)-(4-ethenyl-1,5-dimethyl-2,3-dihydropyridin-6-ylidene)methyl]methanimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(Z)-(4-ethenyl-1,5-dimethyl-2,3-dihydropyridin-6-ylidene)methyl]methanimine?
The IUPAC name of N-[(Z)-(4-ethenyl-1,5-dimethyl-2,3-dihydropyridin-6-ylidene)methyl]methanimine (CID 146370264) is N-[(Z)-(4-ethenyl-1,5-dimethyl-2,3-dihydropyridin-6-ylidene)methyl]methanimine.
What is the SMILES notation for N-[(Z)-(4-ethenyl-1,5-dimethyl-2,3-dihydropyridin-6-ylidene)methyl]methanimine?
The canonical SMILES for N-[(Z)-(4-ethenyl-1,5-dimethyl-2,3-dihydropyridin-6-ylidene)methyl]methanimine is C=CC1=C(C)/C(=C/N=C)N(C)CC1.
What is the InChIKey of N-[(Z)-(4-ethenyl-1,5-dimethyl-2,3-dihydropyridin-6-ylidene)methyl]methanimine?
The InChIKey is NBTRRHUCBCZWCY-FLIBITNWSA-N. The full InChI is InChI=1S/C11H16N2/c1-5-10-6-7-13(4)11(8-12-3)9(10)2/h5,8H,1,3,6-7H2,2,4H3/b11-8-.
What are the key properties of N-[(Z)-(4-ethenyl-1,5-dimethyl-2,3-dihydropyridin-6-ylidene)methyl]methanimine?
N-[(Z)-(4-ethenyl-1,5-dimethyl-2,3-dihydropyridin-6-ylidene)methyl]methanimine has a molecular weight of 176.26 g/mol, XLogP of 2.37, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(Z)-(4-ethenyl-1,5-dimethyl-2,3-dihydropyridin-6-ylidene)methyl]methanimine is sourced from PubChem (CID 146370264), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).