About (2,4-dichloroanilino)-(1,3-dihydroisoindol-2-yl)methanol
(2,4-dichloroanilino)-(1,3-dihydroisoindol-2-yl)methanol (PubChem CID 146370347) has the molecular formula C15H14Cl2N2O
and a molecular weight of 309.20 g/mol. Its IUPAC name is (2,4-dichloroanilino)-(1,3-dihydroisoindol-2-yl)methanol.
Molecular Properties
| Compound Name | (2,4-dichloroanilino)-(1,3-dihydroisoindol-2-yl)methanol |
| PubChem CID | 146370347 |
| Molecular Formula | C15H14Cl2N2O |
| Molecular Weight | 309.20 g/mol |
| Exact Mass | 308.05 |
| IUPAC Name | (2,4-dichloroanilino)-(1,3-dihydroisoindol-2-yl)methanol |
| SMILES | OC(Nc1ccc(Cl)cc1Cl)N1Cc2ccccc2C1 |
| InChI | InChI=1S/C15H14Cl2N2O/c16-12-5-6-14(13(17)7-12)18-15(20)19-8-10-3-1-2-4-11(10)9-19/h1-7,15,18,20H,8-9H2 |
| InChIKey | VETFWLLPTQLWHR-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 309.20 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze (2,4-dichloroanilino)-(1,3-dihydroisoindol-2-yl)methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2,4-dichloroanilino)-(1,3-dihydroisoindol-2-yl)methanol?
The IUPAC name of (2,4-dichloroanilino)-(1,3-dihydroisoindol-2-yl)methanol (CID 146370347) is (2,4-dichloroanilino)-(1,3-dihydroisoindol-2-yl)methanol.
What is the SMILES notation for (2,4-dichloroanilino)-(1,3-dihydroisoindol-2-yl)methanol?
The canonical SMILES for (2,4-dichloroanilino)-(1,3-dihydroisoindol-2-yl)methanol is OC(Nc1ccc(Cl)cc1Cl)N1Cc2ccccc2C1.
What is the InChIKey of (2,4-dichloroanilino)-(1,3-dihydroisoindol-2-yl)methanol?
The InChIKey is VETFWLLPTQLWHR-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H14Cl2N2O/c16-12-5-6-14(13(17)7-12)18-15(20)19-8-10-3-1-2-4-11(10)9-19/h1-7,15,18,20H,8-9H2.
What are the key properties of (2,4-dichloroanilino)-(1,3-dihydroisoindol-2-yl)methanol?
(2,4-dichloroanilino)-(1,3-dihydroisoindol-2-yl)methanol has a molecular weight of 309.20 g/mol, XLogP of 3.70, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2,4-dichloroanilino)-(1,3-dihydroisoindol-2-yl)methanol is sourced from PubChem (CID 146370347), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).