About [(3Z)-2,2-difluorocyclooct-3-en-1-yl] methyl carbonate
[(3Z)-2,2-difluorocyclooct-3-en-1-yl] methyl carbonate (PubChem CID 146370502) has the molecular formula C10H14F2O3
and a molecular weight of 220.21 g/mol. Its IUPAC name is [(3Z)-2,2-difluorocyclooct-3-en-1-yl] methyl carbonate.
Molecular Properties
| Compound Name | [(3Z)-2,2-difluorocyclooct-3-en-1-yl] methyl carbonate |
| PubChem CID | 146370502 |
| Molecular Formula | C10H14F2O3 |
| Molecular Weight | 220.21 g/mol |
| Exact Mass | 220.09 |
| IUPAC Name | [(3Z)-2,2-difluorocyclooct-3-en-1-yl] methyl carbonate |
| SMILES | COC(=O)OC1CCCC/C=C\C1(F)F |
| InChI | InChI=1S/C10H14F2O3/c1-14-9(13)15-8-6-4-2-3-5-7-10(8,11)12/h5,7-8H,2-4,6H2,1H3/b7-5- |
| InChIKey | HUIOCBJFRUWMQJ-ALCCZGGFSA-N |
| XLogP | 2.90 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.21 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze [(3Z)-2,2-difluorocyclooct-3-en-1-yl] methyl carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(3Z)-2,2-difluorocyclooct-3-en-1-yl] methyl carbonate?
The IUPAC name of [(3Z)-2,2-difluorocyclooct-3-en-1-yl] methyl carbonate (CID 146370502) is [(3Z)-2,2-difluorocyclooct-3-en-1-yl] methyl carbonate.
What is the SMILES notation for [(3Z)-2,2-difluorocyclooct-3-en-1-yl] methyl carbonate?
The canonical SMILES for [(3Z)-2,2-difluorocyclooct-3-en-1-yl] methyl carbonate is COC(=O)OC1CCCC/C=C\C1(F)F.
What is the InChIKey of [(3Z)-2,2-difluorocyclooct-3-en-1-yl] methyl carbonate?
The InChIKey is HUIOCBJFRUWMQJ-ALCCZGGFSA-N. The full InChI is InChI=1S/C10H14F2O3/c1-14-9(13)15-8-6-4-2-3-5-7-10(8,11)12/h5,7-8H,2-4,6H2,1H3/b7-5-.
What are the key properties of [(3Z)-2,2-difluorocyclooct-3-en-1-yl] methyl carbonate?
[(3Z)-2,2-difluorocyclooct-3-en-1-yl] methyl carbonate has a molecular weight of 220.21 g/mol, XLogP of 2.90, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(3Z)-2,2-difluorocyclooct-3-en-1-yl] methyl carbonate is sourced from PubChem (CID 146370502), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).