C15H4I3NO5 — CID 146370611
(1,3-dioxo-4,7-epoxyisoindol-2-yl) 2,3,6-triiodobenzoate (PubChem CID 146370611) has the molecular formula C15H4I3NO5 and a molecular weight of 658.91 g/mol. Its IUPAC name is (1,3-dioxo-4,7-epoxyisoindol-2-yl) 2,3,6-triiodobenzoate.
| Compound Name | (1,3-dioxo-4,7-epoxyisoindol-2-yl) 2,3,6-triiodobenzoate |
|---|---|
| PubChem CID | 146370611 |
| Molecular Formula | C15H4I3NO5 |
| Molecular Weight | 658.91 g/mol |
| Exact Mass | 658.72 |
| IUPAC Name | (1,3-dioxo-4,7-epoxyisoindol-2-yl) 2,3,6-triiodobenzoate |
| SMILES | O=C(ON1C(=O)c2c(c3ccc2o3)C1=O)c1c(I)ccc(I)c1I |
| InChI | InChI=1S/C15H4I3NO5/c16-5-1-2-6(17)12(18)9(5)15(22)24-19-13(20)10-7-3-4-8(23-7)11(10)14(19)21/h1-4H |
| InChIKey | WYUQFEDUXSBHNF-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 76.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 658.91 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|