About methyl 3-(4-fluoro-2,5-dimethylphenyl)-5-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]benzoate
methyl 3-(4-fluoro-2,5-dimethylphenyl)-5-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]benzoate (PubChem CID 146371062) has the molecular formula C22H26FNO4
and a molecular weight of 387.45 g/mol. Its IUPAC name is methyl 3-(4-fluoro-2,5-dimethylphenyl)-5-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]benzoate.
Molecular Properties
| Compound Name | methyl 3-(4-fluoro-2,5-dimethylphenyl)-5-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]benzoate |
| PubChem CID | 146371062 |
| Molecular Formula | C22H26FNO4 |
| Molecular Weight | 387.45 g/mol |
| Exact Mass | 387.18 |
| IUPAC Name | methyl 3-(4-fluoro-2,5-dimethylphenyl)-5-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]benzoate |
| SMILES | COC(=O)c1cc(CNC(=O)OC(C)(C)C)cc(-c2cc(C)c(F)cc2C)c1 |
| InChI | InChI=1S/C22H26FNO4/c1-13-8-19(23)14(2)7-18(13)16-9-15(10-17(11-16)20(25)27-6)12-24-21(26)28-22(3,4)5/h7-11H,12H2,1-6H3,(H,24,26) |
| InChIKey | OZPRXMPXCXNBMG-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 387.45 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze methyl 3-(4-fluoro-2,5-dimethylphenyl)-5-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 3-(4-fluoro-2,5-dimethylphenyl)-5-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]benzoate?
The IUPAC name of methyl 3-(4-fluoro-2,5-dimethylphenyl)-5-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]benzoate (CID 146371062) is methyl 3-(4-fluoro-2,5-dimethylphenyl)-5-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]benzoate.
What is the SMILES notation for methyl 3-(4-fluoro-2,5-dimethylphenyl)-5-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]benzoate?
The canonical SMILES for methyl 3-(4-fluoro-2,5-dimethylphenyl)-5-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]benzoate is COC(=O)c1cc(CNC(=O)OC(C)(C)C)cc(-c2cc(C)c(F)cc2C)c1.
What is the InChIKey of methyl 3-(4-fluoro-2,5-dimethylphenyl)-5-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]benzoate?
The InChIKey is OZPRXMPXCXNBMG-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H26FNO4/c1-13-8-19(23)14(2)7-18(13)16-9-15(10-17(11-16)20(25)27-6)12-24-21(26)28-22(3,4)5/h7-11H,12H2,1-6H3,(H,24,26).
What are the key properties of methyl 3-(4-fluoro-2,5-dimethylphenyl)-5-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]benzoate?
methyl 3-(4-fluoro-2,5-dimethylphenyl)-5-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]benzoate has a molecular weight of 387.45 g/mol, XLogP of 4.92, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-(4-fluoro-2,5-dimethylphenyl)-5-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]benzoate is sourced from PubChem (CID 146371062), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).