C18H19F3N4O3 — CID 146371738
[(9S,13S)-3-(difluoromethyl)-10-fluoro-9-methyl-8-oxo-3,4,7-triazatricyclo[12.3.1.02,6]octadeca-1(18),2(6),4,14,16-pentaen-13-yl]carbamic acid (PubChem CID 146371738) has the molecular formula C18H19F3N4O3 and a molecular weight of 396.37 g/mol. Its IUPAC name is [(9S,13S)-3-(difluoromethyl)-10-fluoro-9-methyl-8-oxo-3,4,7-triazatricyclo[12.3.1.02,6]octadeca-1(18),2(6),4,14,16-pentaen-13-yl]carbamic acid.
| Compound Name | [(9S,13S)-3-(difluoromethyl)-10-fluoro-9-methyl-8-oxo-3,4,7-triazatricyclo[12.3.1.02,6]octadeca-1(18),2(6),4,14,16-pentaen-13-yl]carbamic acid |
|---|---|
| PubChem CID | 146371738 |
| Molecular Formula | C18H19F3N4O3 |
| Molecular Weight | 396.37 g/mol |
| Exact Mass | 396.14 |
| IUPAC Name | [(9S,13S)-3-(difluoromethyl)-10-fluoro-9-methyl-8-oxo-3,4,7-triazatricyclo[12.3.1.02,6]octadeca-1(18),2(6),4,14,16-pentaen-13-yl]carbamic acid |
| SMILES | C[C@H]1C(=O)Nc2cnn(C(F)F)c2-c2cccc(c2)[C@@H](NC(=O)O)CCC1F |
| InChI | InChI=1S/C18H19F3N4O3/c1-9-12(19)5-6-13(24-18(27)28)10-3-2-4-11(7-10)15-14(23-16(9)26)8-22-25(15)17(20)21/h2-4,7-9,12-13,17,24H,5-6H2,1H3,(H,23,26)(H,27,28)/t9-,12?,13+/m1/s1 |
| InChIKey | YQZCERSXUNMEAQ-SDGSVYFJSA-N |
| XLogP | 3.96 |
| TPSA | 96.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.37 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |