C9H9ClN2O3S — CID 146372436
7-chlorospiro[2,3-dihydropyrido[2,3-b][1,4,5]oxathiazepine-4,1'-cyclopropane] 1,1-dioxide (PubChem CID 146372436) has the molecular formula C9H9ClN2O3S and a molecular weight of 260.70 g/mol. Its IUPAC name is 7-chlorospiro[2,3-dihydropyrido[2,3-b][1,4,5]oxathiazepine-4,1'-cyclopropane] 1,1-dioxide.
| Compound Name | 7-chlorospiro[2,3-dihydropyrido[2,3-b][1,4,5]oxathiazepine-4,1'-cyclopropane] 1,1-dioxide |
|---|---|
| PubChem CID | 146372436 |
| Molecular Formula | C9H9ClN2O3S |
| Molecular Weight | 260.70 g/mol |
| Exact Mass | 260.00 |
| IUPAC Name | 7-chlorospiro[2,3-dihydropyrido[2,3-b][1,4,5]oxathiazepine-4,1'-cyclopropane] 1,1-dioxide |
| SMILES | O=S1(=O)NCC2(CC2)Oc2nc(Cl)ccc21 |
| InChI | InChI=1S/C9H9ClN2O3S/c10-7-2-1-6-8(12-7)15-9(3-4-9)5-11-16(6,13)14/h1-2,11H,3-5H2 |
| InChIKey | QQDLKYMKWOAEPW-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.70 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|