C29H33N5O5S — CID 146372734
3-[3-[(4,4-dimethyl-1,1-dioxo-3H-pyrido[2,3-b][1,4,5]oxathiazepin-2-yl)methyl]-4-methylphenyl]-3-(1-ethyl-4-methylbenzotriazol-5-yl)propanoic acid (PubChem CID 146372734) has the molecular formula C29H33N5O5S and a molecular weight of 563.68 g/mol. Its IUPAC name is 3-[3-[(4,4-dimethyl-1,1-dioxo-3H-pyrido[2,3-b][1,4,5]oxathiazepin-2-yl)methyl]-4-methylphenyl]-3-(1-ethyl-4-methylbenzotriazol-5-yl)propanoic acid.
| Compound Name | 3-[3-[(4,4-dimethyl-1,1-dioxo-3H-pyrido[2,3-b][1,4,5]oxathiazepin-2-yl)methyl]-4-methylphenyl]-3-(1-ethyl-4-methylbenzotriazol-5-yl)propanoic acid |
|---|---|
| PubChem CID | 146372734 |
| Molecular Formula | C29H33N5O5S |
| Molecular Weight | 563.68 g/mol |
| Exact Mass | 563.22 |
| IUPAC Name | 3-[3-[(4,4-dimethyl-1,1-dioxo-3H-pyrido[2,3-b][1,4,5]oxathiazepin-2-yl)methyl]-4-methylphenyl]-3-(1-ethyl-4-methylbenzotriazol-5-yl)propanoic acid |
| SMILES | CCn1nnc2c(C)c(C(CC(=O)O)c3ccc(C)c(CN4CC(C)(C)Oc5ncccc5S4(=O)=O)c3)ccc21 |
| InChI | InChI=1S/C29H33N5O5S/c1-6-34-24-12-11-22(19(3)27(24)31-32-34)23(15-26(35)36)20-10-9-18(2)21(14-20)16-33-17-29(4,5)39-28-25(40(33,37)38)8-7-13-30-28/h7-14,23H,6,15-17H2,1-5H3,(H,35,36) |
| InChIKey | VWURIPGAMBLLGI-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 127.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.68 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |