C31H40N6O3S — CID 146372764
N-(1,1-dihydroxythian-4-yl)-1-methyl-5-[4-(3-piperidin-1-ylpropylamino)-1,6-naphthyridin-2-yl]indole-2-carboxamide (PubChem CID 146372764) has the molecular formula C31H40N6O3S and a molecular weight of 576.77 g/mol. Its IUPAC name is N-(1,1-dihydroxythian-4-yl)-1-methyl-5-[4-(3-piperidin-1-ylpropylamino)-1,6-naphthyridin-2-yl]indole-2-carboxamide.
| Compound Name | N-(1,1-dihydroxythian-4-yl)-1-methyl-5-[4-(3-piperidin-1-ylpropylamino)-1,6-naphthyridin-2-yl]indole-2-carboxamide |
|---|---|
| PubChem CID | 146372764 |
| Molecular Formula | C31H40N6O3S |
| Molecular Weight | 576.77 g/mol |
| Exact Mass | 576.29 |
| IUPAC Name | N-(1,1-dihydroxythian-4-yl)-1-methyl-5-[4-(3-piperidin-1-ylpropylamino)-1,6-naphthyridin-2-yl]indole-2-carboxamide |
| SMILES | Cn1c(C(=O)NC2CCS(O)(O)CC2)cc2cc(-c3cc(NCCCN4CCCCC4)c4cnccc4n3)ccc21 |
| InChI | InChI=1S/C31H40N6O3S/c1-36-29-7-6-22(18-23(29)19-30(36)31(38)34-24-9-16-41(39,40)17-10-24)27-20-28(25-21-32-12-8-26(25)35-27)33-11-5-15-37-13-3-2-4-14-37/h6-8,12,18-21,24,39-40H,2-5,9-11,13-17H2,1H3,(H,33,35)(H,34,38) |
| InChIKey | VUZNPGXJLUQHGF-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 115.54 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.77 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|