About 6-phenylbenzo[d][1,3,2]benzodioxaphosphepine
6-phenylbenzo[d][1,3,2]benzodioxaphosphepine (PubChem CID 14637277) has the molecular formula C18H13O2P
and a molecular weight of 292.27 g/mol. Its IUPAC name is 6-phenylbenzo[d][1,3,2]benzodioxaphosphepine.
Molecular Properties
| Compound Name | 6-phenylbenzo[d][1,3,2]benzodioxaphosphepine |
| PubChem CID | 14637277 |
| Molecular Formula | C18H13O2P |
| Molecular Weight | 292.27 g/mol |
| Exact Mass | 292.07 |
| IUPAC Name | 6-phenylbenzo[d][1,3,2]benzodioxaphosphepine |
| SMILES | c1ccc(-p2oc3ccccc3c3ccccc3o2)cc1 |
| InChI | InChI=1S/C18H13O2P/c1-2-8-14(9-3-1)21-19-17-12-6-4-10-15(17)16-11-5-7-13-18(16)20-21/h1-13H |
| InChIKey | JSGMYADOGOSVSP-UHFFFAOYSA-N |
| XLogP | 6.28 |
| TPSA | 26.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 292.27 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 6-phenylbenzo[d][1,3,2]benzodioxaphosphepine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-phenylbenzo[d][1,3,2]benzodioxaphosphepine?
The IUPAC name of 6-phenylbenzo[d][1,3,2]benzodioxaphosphepine (CID 14637277) is 6-phenylbenzo[d][1,3,2]benzodioxaphosphepine.
What is the SMILES notation for 6-phenylbenzo[d][1,3,2]benzodioxaphosphepine?
The canonical SMILES for 6-phenylbenzo[d][1,3,2]benzodioxaphosphepine is c1ccc(-p2oc3ccccc3c3ccccc3o2)cc1.
What is the InChIKey of 6-phenylbenzo[d][1,3,2]benzodioxaphosphepine?
The InChIKey is JSGMYADOGOSVSP-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H13O2P/c1-2-8-14(9-3-1)21-19-17-12-6-4-10-15(17)16-11-5-7-13-18(16)20-21/h1-13H.
What are the key properties of 6-phenylbenzo[d][1,3,2]benzodioxaphosphepine?
6-phenylbenzo[d][1,3,2]benzodioxaphosphepine has a molecular weight of 292.27 g/mol, XLogP of 6.28, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-phenylbenzo[d][1,3,2]benzodioxaphosphepine is sourced from PubChem (CID 14637277), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).