C29H38N6O2 — CID 146372775
(E)-N-(1-methylpiperidin-4-yl)-3-[5-[4-(3-piperidin-1-ylpropylamino)-1,6-naphthyridin-2-yl]furan-2-yl]prop-2-enamide (PubChem CID 146372775) has the molecular formula C29H38N6O2 and a molecular weight of 502.66 g/mol. Its IUPAC name is (E)-N-(1-methylpiperidin-4-yl)-3-[5-[4-(3-piperidin-1-ylpropylamino)-1,6-naphthyridin-2-yl]furan-2-yl]prop-2-enamide.
| Compound Name | (E)-N-(1-methylpiperidin-4-yl)-3-[5-[4-(3-piperidin-1-ylpropylamino)-1,6-naphthyridin-2-yl]furan-2-yl]prop-2-enamide |
|---|---|
| PubChem CID | 146372775 |
| Molecular Formula | C29H38N6O2 |
| Molecular Weight | 502.66 g/mol |
| Exact Mass | 502.31 |
| IUPAC Name | (E)-N-(1-methylpiperidin-4-yl)-3-[5-[4-(3-piperidin-1-ylpropylamino)-1,6-naphthyridin-2-yl]furan-2-yl]prop-2-enamide |
| SMILES | CN1CCC(NC(=O)/C=C/c2ccc(-c3cc(NCCCN4CCCCC4)c4cnccc4n3)o2)CC1 |
| InChI | InChI=1S/C29H38N6O2/c1-34-18-11-22(12-19-34)32-29(36)9-7-23-6-8-28(37-23)27-20-26(24-21-30-14-10-25(24)33-27)31-13-5-17-35-15-3-2-4-16-35/h6-10,14,20-22H,2-5,11-13,15-19H2,1H3,(H,31,33)(H,32,36)/b9-7+ |
| InChIKey | IJVRYHHWCDVFMP-VQHVLOKHSA-N |
| XLogP | 4.40 |
| TPSA | 86.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.66 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|