C21H30BrClN2O4 — CID 146373465
ethyl 2-[5-bromo-2-chloro-4-(4,4-dimethylpiperidin-1-yl)-6-formyl-3-pyridinyl]-2-[(2-methylpropan-2-yl)oxy]acetate (PubChem CID 146373465) has the molecular formula C21H30BrClN2O4 and a molecular weight of 489.84 g/mol. Its IUPAC name is ethyl 2-[5-bromo-2-chloro-4-(4,4-dimethylpiperidin-1-yl)-6-formyl-3-pyridinyl]-2-[(2-methylpropan-2-yl)oxy]acetate.
| Compound Name | ethyl 2-[5-bromo-2-chloro-4-(4,4-dimethylpiperidin-1-yl)-6-formyl-3-pyridinyl]-2-[(2-methylpropan-2-yl)oxy]acetate |
|---|---|
| PubChem CID | 146373465 |
| Molecular Formula | C21H30BrClN2O4 |
| Molecular Weight | 489.84 g/mol |
| Exact Mass | 488.11 |
| IUPAC Name | ethyl 2-[5-bromo-2-chloro-4-(4,4-dimethylpiperidin-1-yl)-6-formyl-3-pyridinyl]-2-[(2-methylpropan-2-yl)oxy]acetate |
| SMILES | CCOC(=O)C(OC(C)(C)C)c1c(Cl)nc(C=O)c(Br)c1N1CCC(C)(C)CC1 |
| InChI | InChI=1S/C21H30BrClN2O4/c1-7-28-19(27)17(29-20(2,3)4)14-16(15(22)13(12-26)24-18(14)23)25-10-8-21(5,6)9-11-25/h12,17H,7-11H2,1-6H3 |
| InChIKey | MTDLYOIGAWHSAF-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 68.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.84 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|