C20H18O4 — CID 146373657
1-(methoxymethoxy)-4-[4-[4-(methoxymethoxy)phenyl]buta-1,3-diynyl]benzene (PubChem CID 146373657) has the molecular formula C20H18O4 and a molecular weight of 322.36 g/mol. Its IUPAC name is 1-(methoxymethoxy)-4-[4-[4-(methoxymethoxy)phenyl]buta-1,3-diynyl]benzene.
| Compound Name | 1-(methoxymethoxy)-4-[4-[4-(methoxymethoxy)phenyl]buta-1,3-diynyl]benzene |
|---|---|
| PubChem CID | 146373657 |
| Molecular Formula | C20H18O4 |
| Molecular Weight | 322.36 g/mol |
| Exact Mass | 322.12 |
| IUPAC Name | 1-(methoxymethoxy)-4-[4-[4-(methoxymethoxy)phenyl]buta-1,3-diynyl]benzene |
| SMILES | COCOc1ccc(C#CC#Cc2ccc(OCOC)cc2)cc1 |
| InChI | InChI=1S/C20H18O4/c1-21-15-23-19-11-7-17(8-12-19)5-3-4-6-18-9-13-20(14-10-18)24-16-22-2/h7-14H,15-16H2,1-2H3 |
| InChIKey | ASAPZSMZDMIBGO-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.36 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|