C10H16F2N2 — CID 146374112
(2R,7S)-3,5-difluoro-7-methyl-1,2,4a,5,6,7,8,8a-octahydroquinolin-2-amine (PubChem CID 146374112) has the molecular formula C10H16F2N2 and a molecular weight of 202.25 g/mol. Its IUPAC name is (2R,7S)-3,5-difluoro-7-methyl-1,2,4a,5,6,7,8,8a-octahydroquinolin-2-amine.
| Compound Name | (2R,7S)-3,5-difluoro-7-methyl-1,2,4a,5,6,7,8,8a-octahydroquinolin-2-amine |
|---|---|
| PubChem CID | 146374112 |
| Molecular Formula | C10H16F2N2 |
| Molecular Weight | 202.25 g/mol |
| Exact Mass | 202.13 |
| IUPAC Name | (2R,7S)-3,5-difluoro-7-methyl-1,2,4a,5,6,7,8,8a-octahydroquinolin-2-amine |
| SMILES | C[C@@H]1CC(F)C2C=C(F)[C@H](N)NC2C1 |
| InChI | InChI=1S/C10H16F2N2/c1-5-2-7(11)6-4-8(12)10(13)14-9(6)3-5/h4-7,9-10,14H,2-3,13H2,1H3/t5-,6?,7?,9?,10-/m1/s1 |
| InChIKey | YHQBOOPTLPYUGO-JPGAOFRCSA-N |
| XLogP | 1.48 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.25 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |