C9H18FN — CID 146374292
(2R,3S)-2-ethyl-3-fluoro-1-propan-2-ylpyrrolidine (PubChem CID 146374292) has the molecular formula C9H18FN and a molecular weight of 159.25 g/mol. Its IUPAC name is (2R,3S)-2-ethyl-3-fluoro-1-propan-2-ylpyrrolidine.
| Compound Name | (2R,3S)-2-ethyl-3-fluoro-1-propan-2-ylpyrrolidine |
|---|---|
| PubChem CID | 146374292 |
| Molecular Formula | C9H18FN |
| Molecular Weight | 159.25 g/mol |
| Exact Mass | 159.14 |
| IUPAC Name | (2R,3S)-2-ethyl-3-fluoro-1-propan-2-ylpyrrolidine |
| SMILES | CC[C@@H]1[C@@H](F)CCN1C(C)C |
| InChI | InChI=1S/C9H18FN/c1-4-9-8(10)5-6-11(9)7(2)3/h7-9H,4-6H2,1-3H3/t8-,9+/m0/s1 |
| InChIKey | UCCWAYFUPARMOX-DTWKUNHWSA-N |
| XLogP | 2.22 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 159.25 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |