C28H41N — CID 146374322
2-methylidene-5-(7,10,13-trimethyl-3-methylidene-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl)hexanenitrile (PubChem CID 146374322) has the molecular formula C28H41N and a molecular weight of 391.64 g/mol. Its IUPAC name is 2-methylidene-5-(7,10,13-trimethyl-3-methylidene-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl)hexanenitrile.
| Compound Name | 2-methylidene-5-(7,10,13-trimethyl-3-methylidene-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl)hexanenitrile |
|---|---|
| PubChem CID | 146374322 |
| Molecular Formula | C28H41N |
| Molecular Weight | 391.64 g/mol |
| Exact Mass | 391.32 |
| IUPAC Name | 2-methylidene-5-(7,10,13-trimethyl-3-methylidene-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl)hexanenitrile |
| SMILES | C=C(C#N)CCC(C)C1CCC2C3C(C)CC4=CC(=C)CCC4(C)C3CCC12C |
| InChI | InChI=1S/C28H41N/c1-18-11-13-27(5)22(15-18)16-21(4)26-24-10-9-23(20(3)8-7-19(2)17-29)28(24,6)14-12-25(26)27/h15,20-21,23-26H,1-2,7-14,16H2,3-6H3 |
| InChIKey | VJFCVNZBUHWINR-UHFFFAOYSA-N |
| XLogP | 7.86 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.64 |
| LogP ≤ 5 | 7.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|