C9H12F3NO3 — CID 146374348
N-(1,1,1-trifluoro-3-hydroxy-4-oxobutan-2-yl)pent-4-enamide (PubChem CID 146374348) has the molecular formula C9H12F3NO3 and a molecular weight of 239.19 g/mol. Its IUPAC name is N-(1,1,1-trifluoro-3-hydroxy-4-oxobutan-2-yl)pent-4-enamide.
| Compound Name | N-(1,1,1-trifluoro-3-hydroxy-4-oxobutan-2-yl)pent-4-enamide |
|---|---|
| PubChem CID | 146374348 |
| Molecular Formula | C9H12F3NO3 |
| Molecular Weight | 239.19 g/mol |
| Exact Mass | 239.08 |
| IUPAC Name | N-(1,1,1-trifluoro-3-hydroxy-4-oxobutan-2-yl)pent-4-enamide |
| SMILES | C=CCCC(=O)NC(C(O)C=O)C(F)(F)F |
| InChI | InChI=1S/C9H12F3NO3/c1-2-3-4-7(16)13-8(6(15)5-14)9(10,11)12/h2,5-6,8,15H,1,3-4H2,(H,13,16) |
| InChIKey | SKGGBEWBBVTSJB-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.19 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|