About [5,6-di(propan-2-yl)-5-azaspiro[2.4]heptan-2-yl]phosphane
[5,6-di(propan-2-yl)-5-azaspiro[2.4]heptan-2-yl]phosphane (PubChem CID 146374536) has the molecular formula C12H24NP
and a molecular weight of 213.30 g/mol. Its IUPAC name is [5,6-di(propan-2-yl)-5-azaspiro[2.4]heptan-2-yl]phosphane.
Molecular Properties
| Compound Name | [5,6-di(propan-2-yl)-5-azaspiro[2.4]heptan-2-yl]phosphane |
| PubChem CID | 146374536 |
| Molecular Formula | C12H24NP |
| Molecular Weight | 213.30 g/mol |
| Exact Mass | 213.16 |
| IUPAC Name | [5,6-di(propan-2-yl)-5-azaspiro[2.4]heptan-2-yl]phosphane |
| SMILES | CC(C)C1CC2(CC2P)CN1C(C)C |
| InChI | InChI=1S/C12H24NP/c1-8(2)10-5-12(6-11(12)14)7-13(10)9(3)4/h8-11H,5-7,14H2,1-4H3 |
| InChIKey | VRFDMNLMEPVJCJ-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 213.30 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze [5,6-di(propan-2-yl)-5-azaspiro[2.4]heptan-2-yl]phosphane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [5,6-di(propan-2-yl)-5-azaspiro[2.4]heptan-2-yl]phosphane?
The IUPAC name of [5,6-di(propan-2-yl)-5-azaspiro[2.4]heptan-2-yl]phosphane (CID 146374536) is [5,6-di(propan-2-yl)-5-azaspiro[2.4]heptan-2-yl]phosphane.
What is the SMILES notation for [5,6-di(propan-2-yl)-5-azaspiro[2.4]heptan-2-yl]phosphane?
The canonical SMILES for [5,6-di(propan-2-yl)-5-azaspiro[2.4]heptan-2-yl]phosphane is CC(C)C1CC2(CC2P)CN1C(C)C.
What is the InChIKey of [5,6-di(propan-2-yl)-5-azaspiro[2.4]heptan-2-yl]phosphane?
The InChIKey is VRFDMNLMEPVJCJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H24NP/c1-8(2)10-5-12(6-11(12)14)7-13(10)9(3)4/h8-11H,5-7,14H2,1-4H3.
What are the key properties of [5,6-di(propan-2-yl)-5-azaspiro[2.4]heptan-2-yl]phosphane?
[5,6-di(propan-2-yl)-5-azaspiro[2.4]heptan-2-yl]phosphane has a molecular weight of 213.30 g/mol, XLogP of 2.76, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for [5,6-di(propan-2-yl)-5-azaspiro[2.4]heptan-2-yl]phosphane is sourced from PubChem (CID 146374536), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).