About 4-fluoro-1,2-dimethyl-5-(6-methyldodecan-6-yl)imidazole
4-fluoro-1,2-dimethyl-5-(6-methyldodecan-6-yl)imidazole (PubChem CID 146376816) has the molecular formula C18H33FN2
and a molecular weight of 296.47 g/mol. Its IUPAC name is 4-fluoro-1,2-dimethyl-5-(6-methyldodecan-6-yl)imidazole.
Molecular Properties
| Compound Name | 4-fluoro-1,2-dimethyl-5-(6-methyldodecan-6-yl)imidazole |
| PubChem CID | 146376816 |
| Molecular Formula | C18H33FN2 |
| Molecular Weight | 296.47 g/mol |
| Exact Mass | 296.26 |
| IUPAC Name | 4-fluoro-1,2-dimethyl-5-(6-methyldodecan-6-yl)imidazole |
| SMILES | CCCCCCC(C)(CCCCC)c1c(F)nc(C)n1C |
| InChI | InChI=1S/C18H33FN2/c1-6-8-10-12-14-18(4,13-11-9-7-2)16-17(19)20-15(3)21(16)5/h6-14H2,1-5H3 |
| InChIKey | UPFTWPSKRJGJNU-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 296.47 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-fluoro-1,2-dimethyl-5-(6-methyldodecan-6-yl)imidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-fluoro-1,2-dimethyl-5-(6-methyldodecan-6-yl)imidazole?
The IUPAC name of 4-fluoro-1,2-dimethyl-5-(6-methyldodecan-6-yl)imidazole (CID 146376816) is 4-fluoro-1,2-dimethyl-5-(6-methyldodecan-6-yl)imidazole.
What is the SMILES notation for 4-fluoro-1,2-dimethyl-5-(6-methyldodecan-6-yl)imidazole?
The canonical SMILES for 4-fluoro-1,2-dimethyl-5-(6-methyldodecan-6-yl)imidazole is CCCCCCC(C)(CCCCC)c1c(F)nc(C)n1C.
What is the InChIKey of 4-fluoro-1,2-dimethyl-5-(6-methyldodecan-6-yl)imidazole?
The InChIKey is UPFTWPSKRJGJNU-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H33FN2/c1-6-8-10-12-14-18(4,13-11-9-7-2)16-17(19)20-15(3)21(16)5/h6-14H2,1-5H3.
What are the key properties of 4-fluoro-1,2-dimethyl-5-(6-methyldodecan-6-yl)imidazole?
4-fluoro-1,2-dimethyl-5-(6-methyldodecan-6-yl)imidazole has a molecular weight of 296.47 g/mol, XLogP of 5.68, 10 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-fluoro-1,2-dimethyl-5-(6-methyldodecan-6-yl)imidazole is sourced from PubChem (CID 146376816), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).